About 3-(dimethoxyamino)-4,4,4-trifluoro-3-methylbutan-1-ol
3-(dimethoxyamino)-4,4,4-trifluoro-3-methylbutan-1-ol (PubChem CID 14870561) has the molecular formula C7H14F3NO3
and a molecular weight of 217.19 g/mol. Its IUPAC name is 3-(dimethoxyamino)-4,4,4-trifluoro-3-methylbutan-1-ol.
Molecular Properties
| Compound Name | 3-(dimethoxyamino)-4,4,4-trifluoro-3-methylbutan-1-ol |
| PubChem CID | 14870561 |
| Molecular Formula | C7H14F3NO3 |
| Molecular Weight | 217.19 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | 3-(dimethoxyamino)-4,4,4-trifluoro-3-methylbutan-1-ol |
| SMILES | CON(OC)C(C)(CCO)C(F)(F)F |
| InChI | InChI=1S/C7H14F3NO3/c1-6(4-5-12,7(8,9)10)11(13-2)14-3/h12H,4-5H2,1-3H3 |
| InChIKey | PHTPHTDCFKQCIW-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.19 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-(dimethoxyamino)-4,4,4-trifluoro-3-methylbutan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(dimethoxyamino)-4,4,4-trifluoro-3-methylbutan-1-ol?
The IUPAC name of 3-(dimethoxyamino)-4,4,4-trifluoro-3-methylbutan-1-ol (CID 14870561) is 3-(dimethoxyamino)-4,4,4-trifluoro-3-methylbutan-1-ol.
What is the SMILES notation for 3-(dimethoxyamino)-4,4,4-trifluoro-3-methylbutan-1-ol?
The canonical SMILES for 3-(dimethoxyamino)-4,4,4-trifluoro-3-methylbutan-1-ol is CON(OC)C(C)(CCO)C(F)(F)F.
What is the InChIKey of 3-(dimethoxyamino)-4,4,4-trifluoro-3-methylbutan-1-ol?
The InChIKey is PHTPHTDCFKQCIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14F3NO3/c1-6(4-5-12,7(8,9)10)11(13-2)14-3/h12H,4-5H2,1-3H3.
What are the key properties of 3-(dimethoxyamino)-4,4,4-trifluoro-3-methylbutan-1-ol?
3-(dimethoxyamino)-4,4,4-trifluoro-3-methylbutan-1-ol has a molecular weight of 217.19 g/mol, XLogP of 1.11, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(dimethoxyamino)-4,4,4-trifluoro-3-methylbutan-1-ol is sourced from PubChem (CID 14870561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).