About 3-octylsulfanylpropane-1,2-diol
3-octylsulfanylpropane-1,2-diol (PubChem CID 14870587) has the molecular formula C11H24O2S
and a molecular weight of 220.38 g/mol. Its IUPAC name is 3-octylsulfanylpropane-1,2-diol.
Molecular Properties
| Compound Name | 3-octylsulfanylpropane-1,2-diol |
| PubChem CID | 14870587 |
| Molecular Formula | C11H24O2S |
| Molecular Weight | 220.38 g/mol |
| Exact Mass | 220.15 |
| IUPAC Name | 3-octylsulfanylpropane-1,2-diol |
| SMILES | CCCCCCCCSCC(O)CO |
| InChI | InChI=1S/C11H24O2S/c1-2-3-4-5-6-7-8-14-10-11(13)9-12/h11-13H,2-10H2,1H3 |
| InChIKey | BYEWWAPPFCCOKH-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.38 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-octylsulfanylpropane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-octylsulfanylpropane-1,2-diol?
The IUPAC name of 3-octylsulfanylpropane-1,2-diol (CID 14870587) is 3-octylsulfanylpropane-1,2-diol.
What is the SMILES notation for 3-octylsulfanylpropane-1,2-diol?
The canonical SMILES for 3-octylsulfanylpropane-1,2-diol is CCCCCCCCSCC(O)CO.
What is the InChIKey of 3-octylsulfanylpropane-1,2-diol?
The InChIKey is BYEWWAPPFCCOKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H24O2S/c1-2-3-4-5-6-7-8-14-10-11(13)9-12/h11-13H,2-10H2,1H3.
What are the key properties of 3-octylsulfanylpropane-1,2-diol?
3-octylsulfanylpropane-1,2-diol has a molecular weight of 220.38 g/mol, XLogP of 2.43, 10 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-octylsulfanylpropane-1,2-diol is sourced from PubChem (CID 14870587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).