About 11-methyl-9-oxapentacyclo[9.3.0.01,5.02,4.06,10]tetradecane
11-methyl-9-oxapentacyclo[9.3.0.01,5.02,4.06,10]tetradecane (PubChem CID 148710272) has the molecular formula C14H20O
and a molecular weight of 204.31 g/mol. Its IUPAC name is 11-methyl-9-oxapentacyclo[9.3.0.01,5.02,4.06,10]tetradecane.
Analyze 11-methyl-9-oxapentacyclo[9.3.0.01,5.02,4.06,10]tetradecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11-methyl-9-oxapentacyclo[9.3.0.01,5.02,4.06,10]tetradecane?
The IUPAC name of 11-methyl-9-oxapentacyclo[9.3.0.01,5.02,4.06,10]tetradecane (CID 148710272) is 11-methyl-9-oxapentacyclo[9.3.0.01,5.02,4.06,10]tetradecane.
What is the SMILES notation for 11-methyl-9-oxapentacyclo[9.3.0.01,5.02,4.06,10]tetradecane?
The canonical SMILES for 11-methyl-9-oxapentacyclo[9.3.0.01,5.02,4.06,10]tetradecane is CC12CCCC13C1CC1C3C1CCOC12.
What is the InChIKey of 11-methyl-9-oxapentacyclo[9.3.0.01,5.02,4.06,10]tetradecane?
The InChIKey is NXCACLLHCLDGGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20O/c1-13-4-2-5-14(13)10-7-9(10)11(14)8-3-6-15-12(8)13/h8-12H,2-7H2,1H3.
What are the key properties of 11-methyl-9-oxapentacyclo[9.3.0.01,5.02,4.06,10]tetradecane?
11-methyl-9-oxapentacyclo[9.3.0.01,5.02,4.06,10]tetradecane has a molecular weight of 204.31 g/mol, XLogP of 2.85, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 11-methyl-9-oxapentacyclo[9.3.0.01,5.02,4.06,10]tetradecane is sourced from PubChem (CID 148710272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).