C16H25NO — CID 148711602
(3E,5Z)-9-isocyanato-2,2,3,9-tetramethyl-7-methylidenedeca-3,5-diene (PubChem CID 148711602) has the molecular formula C16H25NO and a molecular weight of 247.38 g/mol. Its IUPAC name is (3E,5Z)-9-isocyanato-2,2,3,9-tetramethyl-7-methylidenedeca-3,5-diene.
| Compound Name | (3E,5Z)-9-isocyanato-2,2,3,9-tetramethyl-7-methylidenedeca-3,5-diene |
|---|---|
| PubChem CID | 148711602 |
| Molecular Formula | C16H25NO |
| Molecular Weight | 247.38 g/mol |
| Exact Mass | 247.19 |
| IUPAC Name | (3E,5Z)-9-isocyanato-2,2,3,9-tetramethyl-7-methylidenedeca-3,5-diene |
| SMILES | C=C(/C=C\C=C(/C)C(C)(C)C)CC(C)(C)N=C=O |
| InChI | InChI=1S/C16H25NO/c1-13(11-16(6,7)17-12-18)9-8-10-14(2)15(3,4)5/h8-10H,1,11H2,2-7H3/b9-8-,14-10+ |
| InChIKey | NXIJVLSRACSPCL-MYSCJDEHSA-N |
| XLogP | 4.60 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.38 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|