About 3-[N-methyl-4-(1,3-thiazol-3-ium-2-yldiazenyl)anilino]propyl sulfate
3-[N-methyl-4-(1,3-thiazol-3-ium-2-yldiazenyl)anilino]propyl sulfate (PubChem CID 148712656) has the molecular formula C13H16N4O4S2
and a molecular weight of 356.43 g/mol. Its IUPAC name is 3-[N-methyl-4-(1,3-thiazol-3-ium-2-yldiazenyl)anilino]propyl sulfate.
Molecular Properties
| Compound Name | 3-[N-methyl-4-(1,3-thiazol-3-ium-2-yldiazenyl)anilino]propyl sulfate |
| PubChem CID | 148712656 |
| Molecular Formula | C13H16N4O4S2 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.06 |
| IUPAC Name | 3-[N-methyl-4-(1,3-thiazol-3-ium-2-yldiazenyl)anilino]propyl sulfate |
| SMILES | CN(CCCOS(=O)(=O)[O-])c1ccc(/N=N/c2[nH+]ccs2)cc1 |
| InChI | InChI=1S/C13H16N4O4S2/c1-17(8-2-9-21-23(18,19)20)12-5-3-11(4-6-12)15-16-13-14-7-10-22-13/h3-7,10H,2,8-9H2,1H3,(H,18,19,20)/b16-15+ |
| InChIKey | NXNHSIGLXCJDAS-FOCLMDBBSA-N |
| XLogP | 2.28 |
| TPSA | 108.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 3-[N-methyl-4-(1,3-thiazol-3-ium-2-yldiazenyl)anilino]propyl sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[N-methyl-4-(1,3-thiazol-3-ium-2-yldiazenyl)anilino]propyl sulfate?
The IUPAC name of 3-[N-methyl-4-(1,3-thiazol-3-ium-2-yldiazenyl)anilino]propyl sulfate (CID 148712656) is 3-[N-methyl-4-(1,3-thiazol-3-ium-2-yldiazenyl)anilino]propyl sulfate.
What is the SMILES notation for 3-[N-methyl-4-(1,3-thiazol-3-ium-2-yldiazenyl)anilino]propyl sulfate?
The canonical SMILES for 3-[N-methyl-4-(1,3-thiazol-3-ium-2-yldiazenyl)anilino]propyl sulfate is CN(CCCOS(=O)(=O)[O-])c1ccc(/N=N/c2[nH+]ccs2)cc1.
What is the InChIKey of 3-[N-methyl-4-(1,3-thiazol-3-ium-2-yldiazenyl)anilino]propyl sulfate?
The InChIKey is NXNHSIGLXCJDAS-FOCLMDBBSA-N. The full InChI is InChI=1S/C13H16N4O4S2/c1-17(8-2-9-21-23(18,19)20)12-5-3-11(4-6-12)15-16-13-14-7-10-22-13/h3-7,10H,2,8-9H2,1H3,(H,18,19,20)/b16-15+.
What are the key properties of 3-[N-methyl-4-(1,3-thiazol-3-ium-2-yldiazenyl)anilino]propyl sulfate?
3-[N-methyl-4-(1,3-thiazol-3-ium-2-yldiazenyl)anilino]propyl sulfate has a molecular weight of 356.43 g/mol, XLogP of 2.28, 8 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[N-methyl-4-(1,3-thiazol-3-ium-2-yldiazenyl)anilino]propyl sulfate is sourced from PubChem (CID 148712656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).