C13H16N4O4S2 — CID 148712656
3-[N-methyl-4-(1,3-thiazol-3-ium-2-yldiazenyl)anilino]propyl sulfate (PubChem CID 148712656) has the molecular formula C13H16N4O4S2 and a molecular weight of 356.43 g/mol. Its IUPAC name is 3-[N-methyl-4-(1,3-thiazol-3-ium-2-yldiazenyl)anilino]propyl sulfate.
| Compound Name | 3-[N-methyl-4-(1,3-thiazol-3-ium-2-yldiazenyl)anilino]propyl sulfate |
|---|---|
| PubChem CID | 148712656 |
| Molecular Formula | C13H16N4O4S2 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.06 |
| IUPAC Name | 3-[N-methyl-4-(1,3-thiazol-3-ium-2-yldiazenyl)anilino]propyl sulfate |
| SMILES | CN(CCCOS(=O)(=O)[O-])c1ccc(/N=N/c2[nH+]ccs2)cc1 |
| InChI | InChI=1S/C13H16N4O4S2/c1-17(8-2-9-21-23(18,19)20)12-5-3-11(4-6-12)15-16-13-14-7-10-22-13/h3-7,10H,2,8-9H2,1H3,(H,18,19,20)/b16-15+ |
| InChIKey | NXNHSIGLXCJDAS-FOCLMDBBSA-N |
| XLogP | 2.28 |
| TPSA | 108.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|