C29H34N6O6 — CID 148712702
(5-methyl-2-oxo-1,3-dioxol-4-yl)methyl 3-[[4-[2-(N'-hydrazinylcarbamimidoyl)phenyl]phenyl]methyl]-5-(2-hydroxypropan-2-yl)-2-propylimidazole-4-carboxylate (PubChem CID 148712702) has the molecular formula C29H34N6O6 and a molecular weight of 562.63 g/mol. Its IUPAC name is (5-methyl-2-oxo-1,3-dioxol-4-yl)methyl 3-[[4-[2-(N'-hydrazinylcarbamimidoyl)phenyl]phenyl]methyl]-5-(2-hydroxypropan-2-yl)-2-propylimidazole-4-carboxylate.
| Compound Name | (5-methyl-2-oxo-1,3-dioxol-4-yl)methyl 3-[[4-[2-(N'-hydrazinylcarbamimidoyl)phenyl]phenyl]methyl]-5-(2-hydroxypropan-2-yl)-2-propylimidazole-4-carboxylate |
|---|---|
| PubChem CID | 148712702 |
| Molecular Formula | C29H34N6O6 |
| Molecular Weight | 562.63 g/mol |
| Exact Mass | 562.25 |
| IUPAC Name | (5-methyl-2-oxo-1,3-dioxol-4-yl)methyl 3-[[4-[2-(N'-hydrazinylcarbamimidoyl)phenyl]phenyl]methyl]-5-(2-hydroxypropan-2-yl)-2-propylimidazole-4-carboxylate |
| SMILES | CCCc1nc(C(C)(C)O)c(C(=O)OCc2oc(=O)oc2C)n1Cc1ccc(-c2ccccc2C(N)=NNN)cc1 |
| InChI | InChI=1S/C29H34N6O6/c1-5-8-23-32-25(29(3,4)38)24(27(36)39-16-22-17(2)40-28(37)41-22)35(23)15-18-11-13-19(14-12-18)20-9-6-7-10-21(20)26(30)33-34-31/h6-7,9-14,34,38H,5,8,15-16,31H2,1-4H3,(H2,30,33) |
| InChIKey | NXNOSIRLLURCQH-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 184.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.63 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|