C32H37FN4O4S2 — CID 148712864
(5S)-N-[(4-ethylsulfinylphenyl)methyl]-1'-[1-[3-fluoro-4-(N-formylcarbamimidoyl)phenyl]ethyl]-5-methylspiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-2-carboxamide (PubChem CID 148712864) has the molecular formula C32H37FN4O4S2 and a molecular weight of 624.80 g/mol. Its IUPAC name is (5S)-N-[(4-ethylsulfinylphenyl)methyl]-1'-[1-[3-fluoro-4-(N-formylcarbamimidoyl)phenyl]ethyl]-5-methylspiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-2-carboxamide.
| Compound Name | (5S)-N-[(4-ethylsulfinylphenyl)methyl]-1'-[1-[3-fluoro-4-(N-formylcarbamimidoyl)phenyl]ethyl]-5-methylspiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-2-carboxamide |
|---|---|
| PubChem CID | 148712864 |
| Molecular Formula | C32H37FN4O4S2 |
| Molecular Weight | 624.80 g/mol |
| Exact Mass | 624.22 |
| IUPAC Name | (5S)-N-[(4-ethylsulfinylphenyl)methyl]-1'-[1-[3-fluoro-4-(N-formylcarbamimidoyl)phenyl]ethyl]-5-methylspiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-2-carboxamide |
| SMILES | [H]/N=C(\NC=O)c1ccc(C(C)N2CCC3(CC2)O[C@@H](C)Cc2cc(C(=O)NCc4ccc(S(=O)CC)cc4)sc23)cc1F |
| InChI | InChI=1S/C32H37FN4O4S2/c1-4-43(40)25-8-5-22(6-9-25)18-35-31(39)28-17-24-15-20(2)41-32(29(24)42-28)11-13-37(14-12-32)21(3)23-7-10-26(27(33)16-23)30(34)36-19-38/h5-10,16-17,19-21H,4,11-15,18H2,1-3H3,(H,35,39)(H2,34,36,38)/t20-,21?,43?/m0/s1 |
| InChIKey | NXOIITXLJPRKRM-HNFTXJCKSA-N |
| XLogP | 5.03 |
| TPSA | 111.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.80 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|