C21H21ClF3N3 — CID 148713463
N-[[2-chloro-5-(trifluoromethyl)phenyl]methyl]spiro[1,4-dihydroquinoline-3,4'-piperidine]-2-imine (PubChem CID 148713463) has the molecular formula C21H21ClF3N3 and a molecular weight of 407.87 g/mol. Its IUPAC name is N-[[2-chloro-5-(trifluoromethyl)phenyl]methyl]spiro[1,4-dihydroquinoline-3,4'-piperidine]-2-imine.
| Compound Name | N-[[2-chloro-5-(trifluoromethyl)phenyl]methyl]spiro[1,4-dihydroquinoline-3,4'-piperidine]-2-imine |
|---|---|
| PubChem CID | 148713463 |
| Molecular Formula | C21H21ClF3N3 |
| Molecular Weight | 407.87 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | N-[[2-chloro-5-(trifluoromethyl)phenyl]methyl]spiro[1,4-dihydroquinoline-3,4'-piperidine]-2-imine |
| SMILES | FC(F)(F)c1ccc(Cl)c(C/N=C2\Nc3ccccc3CC23CCNCC3)c1 |
| InChI | InChI=1S/C21H21ClF3N3/c22-17-6-5-16(21(23,24)25)11-15(17)13-27-19-20(7-9-26-10-8-20)12-14-3-1-2-4-18(14)28-19/h1-6,11,26H,7-10,12-13H2,(H,27,28) |
| InChIKey | NXQXOBARYSDCLT-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.87 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|