About 4-hydroxypent-3-en-2-one;platinum;2-pyridin-2-ylpyridine
4-hydroxypent-3-en-2-one;platinum;2-pyridin-2-ylpyridine (PubChem CID 148715736) has the molecular formula C15H16N2O2Pt
and a molecular weight of 451.38 g/mol. Its IUPAC name is 4-hydroxypent-3-en-2-one;platinum;2-pyridin-2-ylpyridine.
Molecular Properties
| Compound Name | 4-hydroxypent-3-en-2-one;platinum;2-pyridin-2-ylpyridine |
| PubChem CID | 148715736 |
| Molecular Formula | C15H16N2O2Pt |
| Molecular Weight | 451.38 g/mol |
| Exact Mass | 451.09 |
| IUPAC Name | 4-hydroxypent-3-en-2-one;platinum;2-pyridin-2-ylpyridine |
| SMILES | CC(=O)C=C(C)O.[Pt].c1ccc(-c2ccccn2)nc1 |
| InChI | InChI=1S/C10H8N2.C5H8O2.Pt/c1-3-7-11-9(5-1)10-6-2-4-8-12-10;1-4(6)3-5(2)7;/h1-8H;3,6H,1-2H3; |
| InChIKey | MCNLMVCLEYSQRL-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 451.38 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4-hydroxypent-3-en-2-one;platinum;2-pyridin-2-ylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxypent-3-en-2-one;platinum;2-pyridin-2-ylpyridine?
The IUPAC name of 4-hydroxypent-3-en-2-one;platinum;2-pyridin-2-ylpyridine (CID 148715736) is 4-hydroxypent-3-en-2-one;platinum;2-pyridin-2-ylpyridine.
What is the SMILES notation for 4-hydroxypent-3-en-2-one;platinum;2-pyridin-2-ylpyridine?
The canonical SMILES for 4-hydroxypent-3-en-2-one;platinum;2-pyridin-2-ylpyridine is CC(=O)C=C(C)O.[Pt].c1ccc(-c2ccccn2)nc1.
What is the InChIKey of 4-hydroxypent-3-en-2-one;platinum;2-pyridin-2-ylpyridine?
The InChIKey is MCNLMVCLEYSQRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2.C5H8O2.Pt/c1-3-7-11-9(5-1)10-6-2-4-8-12-10;1-4(6)3-5(2)7;/h1-8H;3,6H,1-2H3;.
What are the key properties of 4-hydroxypent-3-en-2-one;platinum;2-pyridin-2-ylpyridine?
4-hydroxypent-3-en-2-one;platinum;2-pyridin-2-ylpyridine has a molecular weight of 451.38 g/mol, XLogP of 3.18, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxypent-3-en-2-one;platinum;2-pyridin-2-ylpyridine is sourced from PubChem (CID 148715736), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).