C12H16O3S — CID 14871587
1-(1,2,3,4-tetrahydronaphthalen-1-yl)ethanesulfonic acid (PubChem CID 14871587) has the molecular formula C12H16O3S and a molecular weight of 240.32 g/mol. Its IUPAC name is 1-(1,2,3,4-tetrahydronaphthalen-1-yl)ethanesulfonic acid.
| Compound Name | 1-(1,2,3,4-tetrahydronaphthalen-1-yl)ethanesulfonic acid |
|---|---|
| PubChem CID | 14871587 |
| Molecular Formula | C12H16O3S |
| Molecular Weight | 240.32 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | 1-(1,2,3,4-tetrahydronaphthalen-1-yl)ethanesulfonic acid |
| SMILES | CC(C1CCCc2ccccc21)S(=O)(=O)O |
| InChI | InChI=1S/C12H16O3S/c1-9(16(13,14)15)11-8-4-6-10-5-2-3-7-12(10)11/h2-3,5,7,9,11H,4,6,8H2,1H3,(H,13,14,15) |
| InChIKey | DMBFWZLEQIRGOZ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.32 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|