About 3-(2,5-dioxooxolan-3-yl)propyl butanoate
3-(2,5-dioxooxolan-3-yl)propyl butanoate (PubChem CID 14871738) has the molecular formula C11H16O5
and a molecular weight of 228.24 g/mol. Its IUPAC name is 3-(2,5-dioxooxolan-3-yl)propyl butanoate.
Molecular Properties
| Compound Name | 3-(2,5-dioxooxolan-3-yl)propyl butanoate |
| PubChem CID | 14871738 |
| Molecular Formula | C11H16O5 |
| Molecular Weight | 228.24 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | 3-(2,5-dioxooxolan-3-yl)propyl butanoate |
| SMILES | CCCC(=O)OCCCC1CC(=O)OC1=O |
| InChI | InChI=1S/C11H16O5/c1-2-4-9(12)15-6-3-5-8-7-10(13)16-11(8)14/h8H,2-7H2,1H3 |
| InChIKey | XZTAWOJTSJHRKA-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.24 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 3-(2,5-dioxooxolan-3-yl)propyl butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,5-dioxooxolan-3-yl)propyl butanoate?
The IUPAC name of 3-(2,5-dioxooxolan-3-yl)propyl butanoate (CID 14871738) is 3-(2,5-dioxooxolan-3-yl)propyl butanoate.
What is the SMILES notation for 3-(2,5-dioxooxolan-3-yl)propyl butanoate?
The canonical SMILES for 3-(2,5-dioxooxolan-3-yl)propyl butanoate is CCCC(=O)OCCCC1CC(=O)OC1=O.
What is the InChIKey of 3-(2,5-dioxooxolan-3-yl)propyl butanoate?
The InChIKey is XZTAWOJTSJHRKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O5/c1-2-4-9(12)15-6-3-5-8-7-10(13)16-11(8)14/h8H,2-7H2,1H3.
What are the key properties of 3-(2,5-dioxooxolan-3-yl)propyl butanoate?
3-(2,5-dioxooxolan-3-yl)propyl butanoate has a molecular weight of 228.24 g/mol, XLogP of 1.20, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,5-dioxooxolan-3-yl)propyl butanoate is sourced from PubChem (CID 14871738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).