methyl 5-(2-methyl-1,3-oxazol-5-yl)thiophene-2-carboxylate

C10H9NO3S — CID 14871937

IUPACmethyl 5-(2-methyl-1,3-oxazol-5-yl)thiophene-2-carboxylate
SMILESCOC(=O)c1ccc(-c2cnc(C)o2)s1
InChIInChI=1S/C10H9NO3S/c1-6-11-5-7(14-6)8-3-4-9(15-8)10(12)13-2/h3-5H,1-2H3
InChIKeyDENNVZWDBLPCKB-UHFFFAOYSA-N
MW223.25 g/mol
LogP2.50
Rot. Bonds2

About methyl 5-(2-methyl-1,3-oxazol-5-yl)thiophene-2-carboxylate

methyl 5-(2-methyl-1,3-oxazol-5-yl)thiophene-2-carboxylate (PubChem CID 14871937) has the molecular formula C10H9NO3S and a molecular weight of 223.25 g/mol. Its IUPAC name is methyl 5-(2-methyl-1,3-oxazol-5-yl)thiophene-2-carboxylate.

Molecular Properties

Compound Namemethyl 5-(2-methyl-1,3-oxazol-5-yl)thiophene-2-carboxylate
PubChem CID14871937
Molecular FormulaC10H9NO3S
Molecular Weight223.25 g/mol
Exact Mass223.03
IUPAC Namemethyl 5-(2-methyl-1,3-oxazol-5-yl)thiophene-2-carboxylate
SMILESCOC(=O)c1ccc(-c2cnc(C)o2)s1
InChIInChI=1S/C10H9NO3S/c1-6-11-5-7(14-6)8-3-4-9(15-8)10(12)13-2/h3-5H,1-2H3
InChIKeyDENNVZWDBLPCKB-UHFFFAOYSA-N
XLogP2.50
TPSA52.33 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500223.25
LogP ≤ 52.50
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze methyl 5-(2-methyl-1,3-oxazol-5-yl)thiophene-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 5-(2-methyl-1,3-oxazol-5-yl)thiophene-2-carboxylate?
The IUPAC name of methyl 5-(2-methyl-1,3-oxazol-5-yl)thiophene-2-carboxylate (CID 14871937) is methyl 5-(2-methyl-1,3-oxazol-5-yl)thiophene-2-carboxylate.
What is the SMILES notation for methyl 5-(2-methyl-1,3-oxazol-5-yl)thiophene-2-carboxylate?
The canonical SMILES for methyl 5-(2-methyl-1,3-oxazol-5-yl)thiophene-2-carboxylate is COC(=O)c1ccc(-c2cnc(C)o2)s1.
What is the InChIKey of methyl 5-(2-methyl-1,3-oxazol-5-yl)thiophene-2-carboxylate?
The InChIKey is DENNVZWDBLPCKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NO3S/c1-6-11-5-7(14-6)8-3-4-9(15-8)10(12)13-2/h3-5H,1-2H3.
What are the key properties of methyl 5-(2-methyl-1,3-oxazol-5-yl)thiophene-2-carboxylate?
methyl 5-(2-methyl-1,3-oxazol-5-yl)thiophene-2-carboxylate has a molecular weight of 223.25 g/mol, XLogP of 2.50, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-(2-methyl-1,3-oxazol-5-yl)thiophene-2-carboxylate is sourced from PubChem (CID 14871937), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).