methyl 5-(5-methyl-1,2,4-oxadiazol-3-yl)thiophene-2-carboxylate

C9H8N2O3S — CID 14871951

IUPACmethyl 5-(5-methyl-1,2,4-oxadiazol-3-yl)thiophene-2-carboxylate
SMILESCOC(=O)c1ccc(-c2noc(C)n2)s1
InChIInChI=1S/C9H8N2O3S/c1-5-10-8(11-14-5)6-3-4-7(15-6)9(12)13-2/h3-4H,1-2H3
InChIKeyWQIRCRDOHVDOGH-UHFFFAOYSA-N
MW224.24 g/mol
LogP1.89
Rot. Bonds2

About methyl 5-(5-methyl-1,2,4-oxadiazol-3-yl)thiophene-2-carboxylate

methyl 5-(5-methyl-1,2,4-oxadiazol-3-yl)thiophene-2-carboxylate (PubChem CID 14871951) has the molecular formula C9H8N2O3S and a molecular weight of 224.24 g/mol. Its IUPAC name is methyl 5-(5-methyl-1,2,4-oxadiazol-3-yl)thiophene-2-carboxylate.

Molecular Properties

Compound Namemethyl 5-(5-methyl-1,2,4-oxadiazol-3-yl)thiophene-2-carboxylate
PubChem CID14871951
Molecular FormulaC9H8N2O3S
Molecular Weight224.24 g/mol
Exact Mass224.03
IUPAC Namemethyl 5-(5-methyl-1,2,4-oxadiazol-3-yl)thiophene-2-carboxylate
SMILESCOC(=O)c1ccc(-c2noc(C)n2)s1
InChIInChI=1S/C9H8N2O3S/c1-5-10-8(11-14-5)6-3-4-7(15-6)9(12)13-2/h3-4H,1-2H3
InChIKeyWQIRCRDOHVDOGH-UHFFFAOYSA-N
XLogP1.89
TPSA65.22 Ų
H-Bond Donors
H-Bond Acceptors6
Rotatable Bonds2
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500224.24
LogP ≤ 51.89
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 106

Analyze methyl 5-(5-methyl-1,2,4-oxadiazol-3-yl)thiophene-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 5-(5-methyl-1,2,4-oxadiazol-3-yl)thiophene-2-carboxylate?
The IUPAC name of methyl 5-(5-methyl-1,2,4-oxadiazol-3-yl)thiophene-2-carboxylate (CID 14871951) is methyl 5-(5-methyl-1,2,4-oxadiazol-3-yl)thiophene-2-carboxylate.
What is the SMILES notation for methyl 5-(5-methyl-1,2,4-oxadiazol-3-yl)thiophene-2-carboxylate?
The canonical SMILES for methyl 5-(5-methyl-1,2,4-oxadiazol-3-yl)thiophene-2-carboxylate is COC(=O)c1ccc(-c2noc(C)n2)s1.
What is the InChIKey of methyl 5-(5-methyl-1,2,4-oxadiazol-3-yl)thiophene-2-carboxylate?
The InChIKey is WQIRCRDOHVDOGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2O3S/c1-5-10-8(11-14-5)6-3-4-7(15-6)9(12)13-2/h3-4H,1-2H3.
What are the key properties of methyl 5-(5-methyl-1,2,4-oxadiazol-3-yl)thiophene-2-carboxylate?
methyl 5-(5-methyl-1,2,4-oxadiazol-3-yl)thiophene-2-carboxylate has a molecular weight of 224.24 g/mol, XLogP of 1.89, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-(5-methyl-1,2,4-oxadiazol-3-yl)thiophene-2-carboxylate is sourced from PubChem (CID 14871951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).