About 10-phenyl-4a,10a-dihydrophenothiazine
10-phenyl-4a,10a-dihydrophenothiazine (PubChem CID 148719639) has the molecular formula C18H15NS
and a molecular weight of 277.39 g/mol. Its IUPAC name is 10-phenyl-4a,10a-dihydrophenothiazine.
Molecular Properties
| Compound Name | 10-phenyl-4a,10a-dihydrophenothiazine |
| PubChem CID | 148719639 |
| Molecular Formula | C18H15NS |
| Molecular Weight | 277.39 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | 10-phenyl-4a,10a-dihydrophenothiazine |
| SMILES | C1=CC2Sc3ccccc3N(c3ccccc3)C2C=C1 |
| InChI | InChI=1S/C18H15NS/c1-2-8-14(9-3-1)19-15-10-4-6-12-17(15)20-18-13-7-5-11-16(18)19/h1-13,15,17H |
| InChIKey | NYVDMUOQRSCVTQ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.39 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 10-phenyl-4a,10a-dihydrophenothiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-phenyl-4a,10a-dihydrophenothiazine?
The IUPAC name of 10-phenyl-4a,10a-dihydrophenothiazine (CID 148719639) is 10-phenyl-4a,10a-dihydrophenothiazine.
What is the SMILES notation for 10-phenyl-4a,10a-dihydrophenothiazine?
The canonical SMILES for 10-phenyl-4a,10a-dihydrophenothiazine is C1=CC2Sc3ccccc3N(c3ccccc3)C2C=C1.
What is the InChIKey of 10-phenyl-4a,10a-dihydrophenothiazine?
The InChIKey is NYVDMUOQRSCVTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15NS/c1-2-8-14(9-3-1)19-15-10-4-6-12-17(15)20-18-13-7-5-11-16(18)19/h1-13,15,17H.
What are the key properties of 10-phenyl-4a,10a-dihydrophenothiazine?
10-phenyl-4a,10a-dihydrophenothiazine has a molecular weight of 277.39 g/mol, XLogP of 4.79, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 10-phenyl-4a,10a-dihydrophenothiazine is sourced from PubChem (CID 148719639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).