C15H9NS — CID 14871970
[1]benzothiolo[2,3-h]isoquinoline (PubChem CID 14871970) has the molecular formula C15H9NS and a molecular weight of 235.31 g/mol. Its IUPAC name is [1]benzothiolo[2,3-h]isoquinoline.
| Compound Name | [1]benzothiolo[2,3-h]isoquinoline |
|---|---|
| PubChem CID | 14871970 |
| Molecular Formula | C15H9NS |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.05 |
| IUPAC Name | [1]benzothiolo[2,3-h]isoquinoline |
| SMILES | c1ccc2c(c1)sc1ccc3ccncc3c12 |
| InChI | InChI=1S/C15H9NS/c1-2-4-13-11(3-1)15-12-9-16-8-7-10(12)5-6-14(15)17-13/h1-9H |
| InChIKey | TZBKYIVIGQHPEA-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |