About 5-fluoro-2-(2-fluoro-5H-pyrrolo[2,3-b]pyrazin-7-yl)-6-(1,3-thiazol-2-yl)pyrimidin-4-amine
5-fluoro-2-(2-fluoro-5H-pyrrolo[2,3-b]pyrazin-7-yl)-6-(1,3-thiazol-2-yl)pyrimidin-4-amine (PubChem CID 148720102) has the molecular formula C13H7F2N7S
and a molecular weight of 331.31 g/mol. Its IUPAC name is 5-fluoro-2-(2-fluoro-5H-pyrrolo[2,3-b]pyrazin-7-yl)-6-(1,3-thiazol-2-yl)pyrimidin-4-amine.
Molecular Properties
| Compound Name | 5-fluoro-2-(2-fluoro-5H-pyrrolo[2,3-b]pyrazin-7-yl)-6-(1,3-thiazol-2-yl)pyrimidin-4-amine |
| PubChem CID | 148720102 |
| Molecular Formula | C13H7F2N7S |
| Molecular Weight | 331.31 g/mol |
| Exact Mass | 331.05 |
| IUPAC Name | 5-fluoro-2-(2-fluoro-5H-pyrrolo[2,3-b]pyrazin-7-yl)-6-(1,3-thiazol-2-yl)pyrimidin-4-amine |
| SMILES | Nc1nc(-c2c[nH]c3ncc(F)nc23)nc(-c2nccs2)c1F |
| InChI | InChI=1S/C13H7F2N7S/c14-6-4-19-12-8(20-6)5(3-18-12)11-21-9(7(15)10(16)22-11)13-17-1-2-23-13/h1-4H,(H,18,19)(H2,16,21,22) |
| InChIKey | NYXMCZSHHBGBQB-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 106.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.31 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 5-fluoro-2-(2-fluoro-5H-pyrrolo[2,3-b]pyrazin-7-yl)-6-(1,3-thiazol-2-yl)pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-2-(2-fluoro-5H-pyrrolo[2,3-b]pyrazin-7-yl)-6-(1,3-thiazol-2-yl)pyrimidin-4-amine?
The IUPAC name of 5-fluoro-2-(2-fluoro-5H-pyrrolo[2,3-b]pyrazin-7-yl)-6-(1,3-thiazol-2-yl)pyrimidin-4-amine (CID 148720102) is 5-fluoro-2-(2-fluoro-5H-pyrrolo[2,3-b]pyrazin-7-yl)-6-(1,3-thiazol-2-yl)pyrimidin-4-amine.
What is the SMILES notation for 5-fluoro-2-(2-fluoro-5H-pyrrolo[2,3-b]pyrazin-7-yl)-6-(1,3-thiazol-2-yl)pyrimidin-4-amine?
The canonical SMILES for 5-fluoro-2-(2-fluoro-5H-pyrrolo[2,3-b]pyrazin-7-yl)-6-(1,3-thiazol-2-yl)pyrimidin-4-amine is Nc1nc(-c2c[nH]c3ncc(F)nc23)nc(-c2nccs2)c1F.
What is the InChIKey of 5-fluoro-2-(2-fluoro-5H-pyrrolo[2,3-b]pyrazin-7-yl)-6-(1,3-thiazol-2-yl)pyrimidin-4-amine?
The InChIKey is NYXMCZSHHBGBQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H7F2N7S/c14-6-4-19-12-8(20-6)5(3-18-12)11-21-9(7(15)10(16)22-11)13-17-1-2-23-13/h1-4H,(H,18,19)(H2,16,21,22).
What are the key properties of 5-fluoro-2-(2-fluoro-5H-pyrrolo[2,3-b]pyrazin-7-yl)-6-(1,3-thiazol-2-yl)pyrimidin-4-amine?
5-fluoro-2-(2-fluoro-5H-pyrrolo[2,3-b]pyrazin-7-yl)-6-(1,3-thiazol-2-yl)pyrimidin-4-amine has a molecular weight of 331.31 g/mol, XLogP of 2.40, 2 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-2-(2-fluoro-5H-pyrrolo[2,3-b]pyrazin-7-yl)-6-(1,3-thiazol-2-yl)pyrimidin-4-amine is sourced from PubChem (CID 148720102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).