C20H22N4O3S — CID 14872074
N,N-diethyl-2-(5-methoxy-10-nitro-8-thia-14,15-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2(7),3,5,9,11,13(16)-heptaen-14-yl)ethanamine (PubChem CID 14872074) has the molecular formula C20H22N4O3S and a molecular weight of 398.49 g/mol. Its IUPAC name is N,N-diethyl-2-(5-methoxy-10-nitro-8-thia-14,15-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2(7),3,5,9,11,13(16)-heptaen-14-yl)ethanamine.
| Compound Name | N,N-diethyl-2-(5-methoxy-10-nitro-8-thia-14,15-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2(7),3,5,9,11,13(16)-heptaen-14-yl)ethanamine |
|---|---|
| PubChem CID | 14872074 |
| Molecular Formula | C20H22N4O3S |
| Molecular Weight | 398.49 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | N,N-diethyl-2-(5-methoxy-10-nitro-8-thia-14,15-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2(7),3,5,9,11,13(16)-heptaen-14-yl)ethanamine |
| SMILES | CCN(CC)CCn1nc2c3c(c([N+](=O)[O-])ccc31)Sc1cc(OC)ccc1-2 |
| InChI | InChI=1S/C20H22N4O3S/c1-4-22(5-2)10-11-23-15-8-9-16(24(25)26)20-18(15)19(21-23)14-7-6-13(27-3)12-17(14)28-20/h6-9,12H,4-5,10-11H2,1-3H3 |
| InChIKey | XHHFKVWESIZGMV-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 73.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.49 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|