About methyl bicyclo[3.2.1]octa-2,6-diene-2-carboxylate
methyl bicyclo[3.2.1]octa-2,6-diene-2-carboxylate (PubChem CID 14872194) has the molecular formula C10H12O2
and a molecular weight of 164.20 g/mol. Its IUPAC name is methyl bicyclo[3.2.1]octa-2,6-diene-2-carboxylate.
Molecular Properties
| Compound Name | methyl bicyclo[3.2.1]octa-2,6-diene-2-carboxylate |
| PubChem CID | 14872194 |
| Molecular Formula | C10H12O2 |
| Molecular Weight | 164.20 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | methyl bicyclo[3.2.1]octa-2,6-diene-2-carboxylate |
| SMILES | COC(=O)C1=CCC2C=CC1C2 |
| InChI | InChI=1S/C10H12O2/c1-12-10(11)9-5-3-7-2-4-8(9)6-7/h2,4-5,7-8H,3,6H2,1H3 |
| InChIKey | AHGMZWJTTILVTD-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.20 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methyl bicyclo[3.2.1]octa-2,6-diene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl bicyclo[3.2.1]octa-2,6-diene-2-carboxylate?
The IUPAC name of methyl bicyclo[3.2.1]octa-2,6-diene-2-carboxylate (CID 14872194) is methyl bicyclo[3.2.1]octa-2,6-diene-2-carboxylate.
What is the SMILES notation for methyl bicyclo[3.2.1]octa-2,6-diene-2-carboxylate?
The canonical SMILES for methyl bicyclo[3.2.1]octa-2,6-diene-2-carboxylate is COC(=O)C1=CCC2C=CC1C2.
What is the InChIKey of methyl bicyclo[3.2.1]octa-2,6-diene-2-carboxylate?
The InChIKey is AHGMZWJTTILVTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O2/c1-12-10(11)9-5-3-7-2-4-8(9)6-7/h2,4-5,7-8H,3,6H2,1H3.
What are the key properties of methyl bicyclo[3.2.1]octa-2,6-diene-2-carboxylate?
methyl bicyclo[3.2.1]octa-2,6-diene-2-carboxylate has a molecular weight of 164.20 g/mol, XLogP of 1.68, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl bicyclo[3.2.1]octa-2,6-diene-2-carboxylate is sourced from PubChem (CID 14872194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).