About 3-cyclopentylimino-2-methylpenta-1,4-dien-1-amine
3-cyclopentylimino-2-methylpenta-1,4-dien-1-amine (PubChem CID 148725137) has the molecular formula C11H18N2
and a molecular weight of 178.28 g/mol. Its IUPAC name is 3-cyclopentylimino-2-methylpenta-1,4-dien-1-amine.
Molecular Properties
| Compound Name | 3-cyclopentylimino-2-methylpenta-1,4-dien-1-amine |
| PubChem CID | 148725137 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | 3-cyclopentylimino-2-methylpenta-1,4-dien-1-amine |
| SMILES | C=C/C(=N\C1CCCC1)C(C)=CN |
| InChI | InChI=1S/C11H18N2/c1-3-11(9(2)8-12)13-10-6-4-5-7-10/h3,8,10H,1,4-7,12H2,2H3/b9-8?,13-11+ |
| InChIKey | CBWVIGBLUOAPSR-XWRNVOKYSA-N |
| XLogP | 2.42 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-cyclopentylimino-2-methylpenta-1,4-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclopentylimino-2-methylpenta-1,4-dien-1-amine?
The IUPAC name of 3-cyclopentylimino-2-methylpenta-1,4-dien-1-amine (CID 148725137) is 3-cyclopentylimino-2-methylpenta-1,4-dien-1-amine.
What is the SMILES notation for 3-cyclopentylimino-2-methylpenta-1,4-dien-1-amine?
The canonical SMILES for 3-cyclopentylimino-2-methylpenta-1,4-dien-1-amine is C=C/C(=N\C1CCCC1)C(C)=CN.
What is the InChIKey of 3-cyclopentylimino-2-methylpenta-1,4-dien-1-amine?
The InChIKey is CBWVIGBLUOAPSR-XWRNVOKYSA-N. The full InChI is InChI=1S/C11H18N2/c1-3-11(9(2)8-12)13-10-6-4-5-7-10/h3,8,10H,1,4-7,12H2,2H3/b9-8?,13-11+.
What are the key properties of 3-cyclopentylimino-2-methylpenta-1,4-dien-1-amine?
3-cyclopentylimino-2-methylpenta-1,4-dien-1-amine has a molecular weight of 178.28 g/mol, XLogP of 2.42, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclopentylimino-2-methylpenta-1,4-dien-1-amine is sourced from PubChem (CID 148725137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).