About [2-(2,4-dichlorophenyl)-2-methyl-1,3-dioxolan-4-yl]methanol
[2-(2,4-dichlorophenyl)-2-methyl-1,3-dioxolan-4-yl]methanol (PubChem CID 14872520) has the molecular formula C11H12Cl2O3
and a molecular weight of 263.12 g/mol. Its IUPAC name is [2-(2,4-dichlorophenyl)-2-methyl-1,3-dioxolan-4-yl]methanol.
Molecular Properties
| Compound Name | [2-(2,4-dichlorophenyl)-2-methyl-1,3-dioxolan-4-yl]methanol |
| PubChem CID | 14872520 |
| Molecular Formula | C11H12Cl2O3 |
| Molecular Weight | 263.12 g/mol |
| Exact Mass | 262.02 |
| IUPAC Name | [2-(2,4-dichlorophenyl)-2-methyl-1,3-dioxolan-4-yl]methanol |
| SMILES | CC1(c2ccc(Cl)cc2Cl)OCC(CO)O1 |
| InChI | InChI=1S/C11H12Cl2O3/c1-11(15-6-8(5-14)16-11)9-3-2-7(12)4-10(9)13/h2-4,8,14H,5-6H2,1H3 |
| InChIKey | NFZUBQHKYXWWNI-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.12 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [2-(2,4-dichlorophenyl)-2-methyl-1,3-dioxolan-4-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2,4-dichlorophenyl)-2-methyl-1,3-dioxolan-4-yl]methanol?
The IUPAC name of [2-(2,4-dichlorophenyl)-2-methyl-1,3-dioxolan-4-yl]methanol (CID 14872520) is [2-(2,4-dichlorophenyl)-2-methyl-1,3-dioxolan-4-yl]methanol.
What is the SMILES notation for [2-(2,4-dichlorophenyl)-2-methyl-1,3-dioxolan-4-yl]methanol?
The canonical SMILES for [2-(2,4-dichlorophenyl)-2-methyl-1,3-dioxolan-4-yl]methanol is CC1(c2ccc(Cl)cc2Cl)OCC(CO)O1.
What is the InChIKey of [2-(2,4-dichlorophenyl)-2-methyl-1,3-dioxolan-4-yl]methanol?
The InChIKey is NFZUBQHKYXWWNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12Cl2O3/c1-11(15-6-8(5-14)16-11)9-3-2-7(12)4-10(9)13/h2-4,8,14H,5-6H2,1H3.
What are the key properties of [2-(2,4-dichlorophenyl)-2-methyl-1,3-dioxolan-4-yl]methanol?
[2-(2,4-dichlorophenyl)-2-methyl-1,3-dioxolan-4-yl]methanol has a molecular weight of 263.12 g/mol, XLogP of 2.57, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2,4-dichlorophenyl)-2-methyl-1,3-dioxolan-4-yl]methanol is sourced from PubChem (CID 14872520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).