C17H22N2O4 — CID 14872894
3-[[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]-methylamino]-4-(3-hydroxypropylamino)cyclobut-3-ene-1,2-dione (PubChem CID 14872894) has the molecular formula C17H22N2O4 and a molecular weight of 318.37 g/mol. Its IUPAC name is 3-[[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]-methylamino]-4-(3-hydroxypropylamino)cyclobut-3-ene-1,2-dione.
| Compound Name | 3-[[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]-methylamino]-4-(3-hydroxypropylamino)cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 14872894 |
| Molecular Formula | C17H22N2O4 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | 3-[[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]-methylamino]-4-(3-hydroxypropylamino)cyclobut-3-ene-1,2-dione |
| SMILES | C[C@@H]([C@H](O)c1ccccc1)N(C)c1c(NCCCO)c(=O)c1=O |
| InChI | InChI=1S/C17H22N2O4/c1-11(15(21)12-7-4-3-5-8-12)19(2)14-13(16(22)17(14)23)18-9-6-10-20/h3-5,7-8,11,15,18,20-21H,6,9-10H2,1-2H3/t11-,15-/m0/s1 |
| InChIKey | HJCXAURGCHCJSC-NHYWBVRUSA-N |
| XLogP | 0.64 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|