C21H28N6 — CID 148730174
4-N-butyl-6-[[3-[(dimethylamino)methyl]phenyl]methyl]pyrido[3,2-d]pyrimidine-2,4-diamine (PubChem CID 148730174) has the molecular formula C21H28N6 and a molecular weight of 364.50 g/mol. Its IUPAC name is 4-N-butyl-6-[[3-[(dimethylamino)methyl]phenyl]methyl]pyrido[3,2-d]pyrimidine-2,4-diamine.
| Compound Name | 4-N-butyl-6-[[3-[(dimethylamino)methyl]phenyl]methyl]pyrido[3,2-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 148730174 |
| Molecular Formula | C21H28N6 |
| Molecular Weight | 364.50 g/mol |
| Exact Mass | 364.24 |
| IUPAC Name | 4-N-butyl-6-[[3-[(dimethylamino)methyl]phenyl]methyl]pyrido[3,2-d]pyrimidine-2,4-diamine |
| SMILES | CCCCNc1nc(N)nc2ccc(Cc3cccc(CN(C)C)c3)nc12 |
| InChI | InChI=1S/C21H28N6/c1-4-5-11-23-20-19-18(25-21(22)26-20)10-9-17(24-19)13-15-7-6-8-16(12-15)14-27(2)3/h6-10,12H,4-5,11,13-14H2,1-3H3,(H3,22,23,25,26) |
| InChIKey | OAUPTPWFYFLHGE-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 79.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.50 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|