About 4-ethenyl-2,6-bis(trifluoromethyl)phenol
4-ethenyl-2,6-bis(trifluoromethyl)phenol (PubChem CID 148734755) has the molecular formula C10H6F6O
and a molecular weight of 256.15 g/mol. Its IUPAC name is 4-ethenyl-2,6-bis(trifluoromethyl)phenol.
Molecular Properties
| Compound Name | 4-ethenyl-2,6-bis(trifluoromethyl)phenol |
| PubChem CID | 148734755 |
| Molecular Formula | C10H6F6O |
| Molecular Weight | 256.15 g/mol |
| Exact Mass | 256.03 |
| IUPAC Name | 4-ethenyl-2,6-bis(trifluoromethyl)phenol |
| SMILES | C=Cc1cc(C(F)(F)F)c(O)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C10H6F6O/c1-2-5-3-6(9(11,12)13)8(17)7(4-5)10(14,15)16/h2-4,17H,1H2 |
| InChIKey | OBRGUMMAGWFIAU-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.15 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-ethenyl-2,6-bis(trifluoromethyl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethenyl-2,6-bis(trifluoromethyl)phenol?
The IUPAC name of 4-ethenyl-2,6-bis(trifluoromethyl)phenol (CID 148734755) is 4-ethenyl-2,6-bis(trifluoromethyl)phenol.
What is the SMILES notation for 4-ethenyl-2,6-bis(trifluoromethyl)phenol?
The canonical SMILES for 4-ethenyl-2,6-bis(trifluoromethyl)phenol is C=Cc1cc(C(F)(F)F)c(O)c(C(F)(F)F)c1.
What is the InChIKey of 4-ethenyl-2,6-bis(trifluoromethyl)phenol?
The InChIKey is OBRGUMMAGWFIAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6F6O/c1-2-5-3-6(9(11,12)13)8(17)7(4-5)10(14,15)16/h2-4,17H,1H2.
What are the key properties of 4-ethenyl-2,6-bis(trifluoromethyl)phenol?
4-ethenyl-2,6-bis(trifluoromethyl)phenol has a molecular weight of 256.15 g/mol, XLogP of 4.07, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethenyl-2,6-bis(trifluoromethyl)phenol is sourced from PubChem (CID 148734755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).