C22H24O7 — CID 14873671
3-butyl-2-(3,4-dihydroxyphenyl)-5,7,8-trimethoxychromen-4-one (PubChem CID 14873671) has the molecular formula C22H24O7 and a molecular weight of 400.43 g/mol. Its IUPAC name is 3-butyl-2-(3,4-dihydroxyphenyl)-5,7,8-trimethoxychromen-4-one.
| Compound Name | 3-butyl-2-(3,4-dihydroxyphenyl)-5,7,8-trimethoxychromen-4-one |
|---|---|
| PubChem CID | 14873671 |
| Molecular Formula | C22H24O7 |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | 3-butyl-2-(3,4-dihydroxyphenyl)-5,7,8-trimethoxychromen-4-one |
| SMILES | CCCCc1c(-c2ccc(O)c(O)c2)oc2c(OC)c(OC)cc(OC)c2c1=O |
| InChI | InChI=1S/C22H24O7/c1-5-6-7-13-19(25)18-16(26-2)11-17(27-3)21(28-4)22(18)29-20(13)12-8-9-14(23)15(24)10-12/h8-11,23-24H,5-7H2,1-4H3 |
| InChIKey | AVVILECDXLRSJJ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 98.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|