About CID 148742691
CID 148742691 (PubChem CID 148742691) has the molecular formula C10H16I2NO2-
and a molecular weight of 436.05 g/mol.
Molecular Properties
| Compound Name | CID 148742691 |
| PubChem CID | 148742691 |
| Molecular Formula | C10H16I2NO2- |
| Molecular Weight | 436.05 g/mol |
| Exact Mass | 435.93 |
| IUPAC Name | — |
| SMILES | CC1(OC(=O)C(I)C2N[I-]2)CCCCC1 |
| InChI | InChI=1S/C10H16I2NO2/c1-10(5-3-2-4-6-10)15-9(14)7(11)8-12-13-8/h7-8,13H,2-6H2,1H3/q-1 |
| InChIKey | KELSNQPPEHXSBB-UHFFFAOYSA-N |
| XLogP | -1.01 |
| TPSA | 48.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 436.05 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze CID 148742691 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 148742691?
The IUPAC name of CID 148742691 (CID 148742691) is not available.
What is the SMILES notation for CID 148742691?
The canonical SMILES for CID 148742691 is CC1(OC(=O)C(I)C2N[I-]2)CCCCC1.
What is the InChIKey of CID 148742691?
The InChIKey is KELSNQPPEHXSBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16I2NO2/c1-10(5-3-2-4-6-10)15-9(14)7(11)8-12-13-8/h7-8,13H,2-6H2,1H3/q-1.
What are the key properties of CID 148742691?
CID 148742691 has a molecular weight of 436.05 g/mol, XLogP of -1.01, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 148742691 is sourced from PubChem (CID 148742691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).