C6H9F4NOSi — CID 14874586
[dimethyl(2,2,3,3-tetrafluoropropoxy)silyl]formonitrile (PubChem CID 14874586) has the molecular formula C6H9F4NOSi and a molecular weight of 215.22 g/mol. Its IUPAC name is [dimethyl(2,2,3,3-tetrafluoropropoxy)silyl]formonitrile.
| Compound Name | [dimethyl(2,2,3,3-tetrafluoropropoxy)silyl]formonitrile |
|---|---|
| PubChem CID | 14874586 |
| Molecular Formula | C6H9F4NOSi |
| Molecular Weight | 215.22 g/mol |
| Exact Mass | 215.04 |
| IUPAC Name | [dimethyl(2,2,3,3-tetrafluoropropoxy)silyl]formonitrile |
| SMILES | C[Si](C)(C#N)OCC(F)(F)C(F)F |
| InChI | InChI=1S/C6H9F4NOSi/c1-13(2,4-11)12-3-6(9,10)5(7)8/h5H,3H2,1-2H3 |
| InChIKey | OYUKIALVIDSHKI-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.22 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|