About 5-ethyl-2-methyl-2-(trifluoromethyl)-1,3-benzoxathiole
5-ethyl-2-methyl-2-(trifluoromethyl)-1,3-benzoxathiole (PubChem CID 14874612) has the molecular formula C11H11F3OS
and a molecular weight of 248.27 g/mol. Its IUPAC name is 5-ethyl-2-methyl-2-(trifluoromethyl)-1,3-benzoxathiole.
Molecular Properties
| Compound Name | 5-ethyl-2-methyl-2-(trifluoromethyl)-1,3-benzoxathiole |
| PubChem CID | 14874612 |
| Molecular Formula | C11H11F3OS |
| Molecular Weight | 248.27 g/mol |
| Exact Mass | 248.05 |
| IUPAC Name | 5-ethyl-2-methyl-2-(trifluoromethyl)-1,3-benzoxathiole |
| SMILES | CCc1ccc2c(c1)SC(C)(C(F)(F)F)O2 |
| InChI | InChI=1S/C11H11F3OS/c1-3-7-4-5-8-9(6-7)16-10(2,15-8)11(12,13)14/h4-6H,3H2,1-2H3 |
| InChIKey | XJNQIWLCYGPPNA-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.27 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-ethyl-2-methyl-2-(trifluoromethyl)-1,3-benzoxathiole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-2-methyl-2-(trifluoromethyl)-1,3-benzoxathiole?
The IUPAC name of 5-ethyl-2-methyl-2-(trifluoromethyl)-1,3-benzoxathiole (CID 14874612) is 5-ethyl-2-methyl-2-(trifluoromethyl)-1,3-benzoxathiole.
What is the SMILES notation for 5-ethyl-2-methyl-2-(trifluoromethyl)-1,3-benzoxathiole?
The canonical SMILES for 5-ethyl-2-methyl-2-(trifluoromethyl)-1,3-benzoxathiole is CCc1ccc2c(c1)SC(C)(C(F)(F)F)O2.
What is the InChIKey of 5-ethyl-2-methyl-2-(trifluoromethyl)-1,3-benzoxathiole?
The InChIKey is XJNQIWLCYGPPNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11F3OS/c1-3-7-4-5-8-9(6-7)16-10(2,15-8)11(12,13)14/h4-6H,3H2,1-2H3.
What are the key properties of 5-ethyl-2-methyl-2-(trifluoromethyl)-1,3-benzoxathiole?
5-ethyl-2-methyl-2-(trifluoromethyl)-1,3-benzoxathiole has a molecular weight of 248.27 g/mol, XLogP of 4.01, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-2-methyl-2-(trifluoromethyl)-1,3-benzoxathiole is sourced from PubChem (CID 14874612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).