C31H37F3N4O3Si — CID 148749476
1-[(3R,4R)-4-methyl-1-[2-[2-(trifluoromethyl)phenyl]acetyl]piperidin-3-yl]-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-h][1,6]naphthyridin-4-one (PubChem CID 148749476) has the molecular formula C31H37F3N4O3Si and a molecular weight of 598.74 g/mol. Its IUPAC name is 1-[(3R,4R)-4-methyl-1-[2-[2-(trifluoromethyl)phenyl]acetyl]piperidin-3-yl]-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-h][1,6]naphthyridin-4-one.
| Compound Name | 1-[(3R,4R)-4-methyl-1-[2-[2-(trifluoromethyl)phenyl]acetyl]piperidin-3-yl]-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-h][1,6]naphthyridin-4-one |
|---|---|
| PubChem CID | 148749476 |
| Molecular Formula | C31H37F3N4O3Si |
| Molecular Weight | 598.74 g/mol |
| Exact Mass | 598.26 |
| IUPAC Name | 1-[(3R,4R)-4-methyl-1-[2-[2-(trifluoromethyl)phenyl]acetyl]piperidin-3-yl]-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-h][1,6]naphthyridin-4-one |
| SMILES | C[C@@H]1CCN(C(=O)Cc2ccccc2C(F)(F)F)C[C@@H]1n1ccc(=O)c2cnc3c(ccn3COCC[Si](C)(C)C)c21 |
| InChI | InChI=1S/C31H37F3N4O3Si/c1-21-9-12-36(28(40)17-22-7-5-6-8-25(22)31(32,33)34)19-26(21)38-14-11-27(39)24-18-35-30-23(29(24)38)10-13-37(30)20-41-15-16-42(2,3)4/h5-8,10-11,13-14,18,21,26H,9,12,15-17,19-20H2,1-4H3/t21-,26+/m1/s1 |
| InChIKey | OEKGZYUWVJQEMD-RLWLMLJZSA-N |
| XLogP | 6.33 |
| TPSA | 69.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.74 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|