C17H9NOS2 — CID 14874972
4,8-dithia-11-azapentacyclo[10.8.0.02,9.03,7.013,18]icosa-1(12),2(9),3(7),5,13,15,17,19-octaen-10-one (PubChem CID 14874972) has the molecular formula C17H9NOS2 and a molecular weight of 307.40 g/mol. Its IUPAC name is 4,8-dithia-11-azapentacyclo[10.8.0.02,9.03,7.013,18]icosa-1(12),2(9),3(7),5,13,15,17,19-octaen-10-one.
| Compound Name | 4,8-dithia-11-azapentacyclo[10.8.0.02,9.03,7.013,18]icosa-1(12),2(9),3(7),5,13,15,17,19-octaen-10-one |
|---|---|
| PubChem CID | 14874972 |
| Molecular Formula | C17H9NOS2 |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.01 |
| IUPAC Name | 4,8-dithia-11-azapentacyclo[10.8.0.02,9.03,7.013,18]icosa-1(12),2(9),3(7),5,13,15,17,19-octaen-10-one |
| SMILES | O=c1[nH]c2c3ccccc3ccc2c2c1sc1ccsc12 |
| InChI | InChI=1S/C17H9NOS2/c19-17-16-13(15-12(21-16)7-8-20-15)11-6-5-9-3-1-2-4-10(9)14(11)18-17/h1-8H,(H,18,19) |
| InChIKey | NPVFMWSWERSAJU-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|