C32H28FN7O3 — CID 148749740
1-[4-[7-(2-fluoro-3-pyridinyl)-4-morpholin-4-ylpyrido[3,2-d]pyrimidin-2-yl]phenyl]-3-[4-(2-oxopropyl)phenyl]urea (PubChem CID 148749740) has the molecular formula C32H28FN7O3 and a molecular weight of 577.62 g/mol. Its IUPAC name is 1-[4-[7-(2-fluoro-3-pyridinyl)-4-morpholin-4-ylpyrido[3,2-d]pyrimidin-2-yl]phenyl]-3-[4-(2-oxopropyl)phenyl]urea.
| Compound Name | 1-[4-[7-(2-fluoro-3-pyridinyl)-4-morpholin-4-ylpyrido[3,2-d]pyrimidin-2-yl]phenyl]-3-[4-(2-oxopropyl)phenyl]urea |
|---|---|
| PubChem CID | 148749740 |
| Molecular Formula | C32H28FN7O3 |
| Molecular Weight | 577.62 g/mol |
| Exact Mass | 577.22 |
| IUPAC Name | 1-[4-[7-(2-fluoro-3-pyridinyl)-4-morpholin-4-ylpyrido[3,2-d]pyrimidin-2-yl]phenyl]-3-[4-(2-oxopropyl)phenyl]urea |
| SMILES | CC(=O)Cc1ccc(NC(=O)Nc2ccc(-c3nc(N4CCOCC4)c4ncc(-c5cccnc5F)cc4n3)cc2)cc1 |
| InChI | InChI=1S/C32H28FN7O3/c1-20(41)17-21-4-8-24(9-5-21)36-32(42)37-25-10-6-22(7-11-25)30-38-27-18-23(26-3-2-12-34-29(26)33)19-35-28(27)31(39-30)40-13-15-43-16-14-40/h2-12,18-19H,13-17H2,1H3,(H2,36,37,42) |
| InChIKey | OELPRZCRAPTQHV-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 122.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.62 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|