C16H21IN2O2 — CID 14875003
1-[(1R,2R)-2-iodocyclohexyl]-3-[2-(4-methylphenyl)-2-oxoethyl]urea (PubChem CID 14875003) has the molecular formula C16H21IN2O2 and a molecular weight of 400.26 g/mol. Its IUPAC name is 1-[(1R,2R)-2-iodocyclohexyl]-3-[2-(4-methylphenyl)-2-oxoethyl]urea.
| Compound Name | 1-[(1R,2R)-2-iodocyclohexyl]-3-[2-(4-methylphenyl)-2-oxoethyl]urea |
|---|---|
| PubChem CID | 14875003 |
| Molecular Formula | C16H21IN2O2 |
| Molecular Weight | 400.26 g/mol |
| Exact Mass | 400.06 |
| IUPAC Name | 1-[(1R,2R)-2-iodocyclohexyl]-3-[2-(4-methylphenyl)-2-oxoethyl]urea |
| SMILES | Cc1ccc(C(=O)CNC(=O)N[C@@H]2CCCC[C@H]2I)cc1 |
| InChI | InChI=1S/C16H21IN2O2/c1-11-6-8-12(9-7-11)15(20)10-18-16(21)19-14-5-3-2-4-13(14)17/h6-9,13-14H,2-5,10H2,1H3,(H2,18,19,21)/t13-,14-/m1/s1 |
| InChIKey | LPYWZIAFXAAQNC-ZIAGYGMSSA-N |
| XLogP | 3.22 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.26 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|