C24H35O7P — CID 148750831
[3-hydroxy-10,13-dimethyl-17-(6-oxopyran-3-yl)-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-14-yl] dihydrogen phosphate (PubChem CID 148750831) has the molecular formula C24H35O7P and a molecular weight of 466.51 g/mol. Its IUPAC name is [3-hydroxy-10,13-dimethyl-17-(6-oxopyran-3-yl)-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-14-yl] dihydrogen phosphate.
| Compound Name | [3-hydroxy-10,13-dimethyl-17-(6-oxopyran-3-yl)-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-14-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 148750831 |
| Molecular Formula | C24H35O7P |
| Molecular Weight | 466.51 g/mol |
| Exact Mass | 466.21 |
| IUPAC Name | [3-hydroxy-10,13-dimethyl-17-(6-oxopyran-3-yl)-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-14-yl] dihydrogen phosphate |
| SMILES | CC12CCC(O)CC1CCC1C2CCC2(C)C(c3ccc(=O)oc3)CCC12OP(=O)(O)O |
| InChI | InChI=1S/C24H35O7P/c1-22-10-7-17(25)13-16(22)4-5-20-19(22)8-11-23(2)18(15-3-6-21(26)30-14-15)9-12-24(20,23)31-32(27,28)29/h3,6,14,16-20,25H,4-5,7-13H2,1-2H3,(H2,27,28,29) |
| InChIKey | OEQWNEBQOCXBGS-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.51 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|