C9H10FNO — CID 148751166
6-fluoro-1,2,3,4-tetrahydroisoquinolin-1-ol (PubChem CID 148751166) has the molecular formula C9H10FNO and a molecular weight of 167.18 g/mol. Its IUPAC name is 6-fluoro-1,2,3,4-tetrahydroisoquinolin-1-ol.
| Compound Name | 6-fluoro-1,2,3,4-tetrahydroisoquinolin-1-ol |
|---|---|
| PubChem CID | 148751166 |
| Molecular Formula | C9H10FNO |
| Molecular Weight | 167.18 g/mol |
| Exact Mass | 167.07 |
| IUPAC Name | 6-fluoro-1,2,3,4-tetrahydroisoquinolin-1-ol |
| SMILES | OC1NCCc2cc(F)ccc21 |
| InChI | InChI=1S/C9H10FNO/c10-7-1-2-8-6(5-7)3-4-11-9(8)12/h1-2,5,9,11-12H,3-4H2 |
| InChIKey | OESKXECZMDZSTP-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.18 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |