C30H33N5O3 — CID 148751271
8-[3-[2-(4-hydroxypiperidin-1-yl)acetyl]-1-(4-isocyanophenyl)-2-methylpyrrolo[3,2-b]pyridin-6-yl]-6-oxooctanenitrile (PubChem CID 148751271) has the molecular formula C30H33N5O3 and a molecular weight of 511.63 g/mol. Its IUPAC name is 8-[3-[2-(4-hydroxypiperidin-1-yl)acetyl]-1-(4-isocyanophenyl)-2-methylpyrrolo[3,2-b]pyridin-6-yl]-6-oxooctanenitrile.
| Compound Name | 8-[3-[2-(4-hydroxypiperidin-1-yl)acetyl]-1-(4-isocyanophenyl)-2-methylpyrrolo[3,2-b]pyridin-6-yl]-6-oxooctanenitrile |
|---|---|
| PubChem CID | 148751271 |
| Molecular Formula | C30H33N5O3 |
| Molecular Weight | 511.63 g/mol |
| Exact Mass | 511.26 |
| IUPAC Name | 8-[3-[2-(4-hydroxypiperidin-1-yl)acetyl]-1-(4-isocyanophenyl)-2-methylpyrrolo[3,2-b]pyridin-6-yl]-6-oxooctanenitrile |
| SMILES | [C-]#[N+]c1ccc(-n2c(C)c(C(=O)CN3CCC(O)CC3)c3ncc(CCC(=O)CCCCC#N)cc32)cc1 |
| InChI | InChI=1S/C30H33N5O3/c1-21-29(28(38)20-34-16-13-26(37)14-17-34)30-27(35(21)24-10-8-23(32-2)9-11-24)18-22(19-33-30)7-12-25(36)6-4-3-5-15-31/h8-11,18-19,26,37H,3-7,12-14,16-17,20H2,1H3 |
| InChIKey | OESWEFFMJXJFQN-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 103.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.63 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|