About (4Z)-5-ethyl-4-methylsulfanylnona-1,4-diene
(4Z)-5-ethyl-4-methylsulfanylnona-1,4-diene (PubChem CID 14875343) has the molecular formula C12H22S
and a molecular weight of 198.38 g/mol. Its IUPAC name is (4Z)-5-ethyl-4-methylsulfanylnona-1,4-diene.
Molecular Properties
| Compound Name | (4Z)-5-ethyl-4-methylsulfanylnona-1,4-diene |
| PubChem CID | 14875343 |
| Molecular Formula | C12H22S |
| Molecular Weight | 198.38 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | (4Z)-5-ethyl-4-methylsulfanylnona-1,4-diene |
| SMILES | C=CC/C(SC)=C(\CC)CCCC |
| InChI | InChI=1S/C12H22S/c1-5-8-10-11(7-3)12(13-4)9-6-2/h6H,2,5,7-10H2,1,3-4H3/b12-11- |
| InChIKey | XKUVOBSUJASUJZ-QXMHVHEDSA-N |
| XLogP | 4.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.38 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (4Z)-5-ethyl-4-methylsulfanylnona-1,4-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4Z)-5-ethyl-4-methylsulfanylnona-1,4-diene?
The IUPAC name of (4Z)-5-ethyl-4-methylsulfanylnona-1,4-diene (CID 14875343) is (4Z)-5-ethyl-4-methylsulfanylnona-1,4-diene.
What is the SMILES notation for (4Z)-5-ethyl-4-methylsulfanylnona-1,4-diene?
The canonical SMILES for (4Z)-5-ethyl-4-methylsulfanylnona-1,4-diene is C=CC/C(SC)=C(\CC)CCCC.
What is the InChIKey of (4Z)-5-ethyl-4-methylsulfanylnona-1,4-diene?
The InChIKey is XKUVOBSUJASUJZ-QXMHVHEDSA-N. The full InChI is InChI=1S/C12H22S/c1-5-8-10-11(7-3)12(13-4)9-6-2/h6H,2,5,7-10H2,1,3-4H3/b12-11-.
What are the key properties of (4Z)-5-ethyl-4-methylsulfanylnona-1,4-diene?
(4Z)-5-ethyl-4-methylsulfanylnona-1,4-diene has a molecular weight of 198.38 g/mol, XLogP of 4.78, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4Z)-5-ethyl-4-methylsulfanylnona-1,4-diene is sourced from PubChem (CID 14875343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).