C4F8O — CID 14875812
(E)-1,2,3,3,3-pentafluoro-1-(trifluoromethoxy)prop-1-ene (PubChem CID 14875812) has the molecular formula C4F8O and a molecular weight of 216.03 g/mol. Its IUPAC name is (E)-1,2,3,3,3-pentafluoro-1-(trifluoromethoxy)prop-1-ene.
| Compound Name | (E)-1,2,3,3,3-pentafluoro-1-(trifluoromethoxy)prop-1-ene |
|---|---|
| PubChem CID | 14875812 |
| Molecular Formula | C4F8O |
| Molecular Weight | 216.03 g/mol |
| Exact Mass | 215.98 |
| IUPAC Name | (E)-1,2,3,3,3-pentafluoro-1-(trifluoromethoxy)prop-1-ene |
| SMILES | F/C(OC(F)(F)F)=C(/F)C(F)(F)F |
| InChI | InChI=1S/C4F8O/c5-1(3(7,8)9)2(6)13-4(10,11)12/b2-1- |
| InChIKey | SYLBHDWIEFOPOP-UPHRSURJSA-N |
| XLogP | 3.19 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.03 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|