About (4,5-dimethoxycyclohexa-2,4-dien-1-yl)methanol
(4,5-dimethoxycyclohexa-2,4-dien-1-yl)methanol (PubChem CID 148758431) has the molecular formula C9H14O3
and a molecular weight of 170.21 g/mol. Its IUPAC name is (4,5-dimethoxycyclohexa-2,4-dien-1-yl)methanol.
Molecular Properties
| Compound Name | (4,5-dimethoxycyclohexa-2,4-dien-1-yl)methanol |
| PubChem CID | 148758431 |
| Molecular Formula | C9H14O3 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.09 |
| IUPAC Name | (4,5-dimethoxycyclohexa-2,4-dien-1-yl)methanol |
| SMILES | COC1=C(OC)CC(CO)C=C1 |
| InChI | InChI=1S/C9H14O3/c1-11-8-4-3-7(6-10)5-9(8)12-2/h3-4,7,10H,5-6H2,1-2H3 |
| InChIKey | OGBIVWQUOWNFTA-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4,5-dimethoxycyclohexa-2,4-dien-1-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4,5-dimethoxycyclohexa-2,4-dien-1-yl)methanol?
The IUPAC name of (4,5-dimethoxycyclohexa-2,4-dien-1-yl)methanol (CID 148758431) is (4,5-dimethoxycyclohexa-2,4-dien-1-yl)methanol.
What is the SMILES notation for (4,5-dimethoxycyclohexa-2,4-dien-1-yl)methanol?
The canonical SMILES for (4,5-dimethoxycyclohexa-2,4-dien-1-yl)methanol is COC1=C(OC)CC(CO)C=C1.
What is the InChIKey of (4,5-dimethoxycyclohexa-2,4-dien-1-yl)methanol?
The InChIKey is OGBIVWQUOWNFTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O3/c1-11-8-4-3-7(6-10)5-9(8)12-2/h3-4,7,10H,5-6H2,1-2H3.
What are the key properties of (4,5-dimethoxycyclohexa-2,4-dien-1-yl)methanol?
(4,5-dimethoxycyclohexa-2,4-dien-1-yl)methanol has a molecular weight of 170.21 g/mol, XLogP of 1.06, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4,5-dimethoxycyclohexa-2,4-dien-1-yl)methanol is sourced from PubChem (CID 148758431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).