C14H13NOS2 — CID 1487598
4-benzyl-2,3-dihydrothieno[3,2-f][1,4]thiazepin-5-one (PubChem CID 1487598) has the molecular formula C14H13NOS2 and a molecular weight of 275.40 g/mol. Its IUPAC name is 4-benzyl-2,3-dihydrothieno[3,2-f][1,4]thiazepin-5-one.
| Compound Name | 4-benzyl-2,3-dihydrothieno[3,2-f][1,4]thiazepin-5-one |
|---|---|
| PubChem CID | 1487598 |
| Molecular Formula | C14H13NOS2 |
| Molecular Weight | 275.40 g/mol |
| Exact Mass | 275.04 |
| IUPAC Name | 4-benzyl-2,3-dihydrothieno[3,2-f][1,4]thiazepin-5-one |
| SMILES | O=C1c2ccsc2SCCN1Cc1ccccc1 |
| InChI | InChI=1S/C14H13NOS2/c16-13-12-6-8-17-14(12)18-9-7-15(13)10-11-4-2-1-3-5-11/h1-6,8H,7,9-10H2 |
| InChIKey | NPPLQBJPWQIERG-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.40 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |