About S-[5-(2-methylprop-2-enoylsulfanyl)-1,4-dithian-2-yl] 2-methylprop-2-enethioate
S-[5-(2-methylprop-2-enoylsulfanyl)-1,4-dithian-2-yl] 2-methylprop-2-enethioate (PubChem CID 14876306) has the molecular formula C12H16O2S4
and a molecular weight of 320.53 g/mol. Its IUPAC name is S-[5-(2-methylprop-2-enoylsulfanyl)-1,4-dithian-2-yl] 2-methylprop-2-enethioate.
Molecular Properties
| Compound Name | S-[5-(2-methylprop-2-enoylsulfanyl)-1,4-dithian-2-yl] 2-methylprop-2-enethioate |
| PubChem CID | 14876306 |
| Molecular Formula | C12H16O2S4 |
| Molecular Weight | 320.53 g/mol |
| Exact Mass | 320.00 |
| IUPAC Name | S-[5-(2-methylprop-2-enoylsulfanyl)-1,4-dithian-2-yl] 2-methylprop-2-enethioate |
| SMILES | C=C(C)C(=O)SC1CSC(SC(=O)C(=C)C)CS1 |
| InChI | InChI=1S/C12H16O2S4/c1-7(2)11(13)17-9-5-16-10(6-15-9)18-12(14)8(3)4/h9-10H,1,3,5-6H2,2,4H3 |
| InChIKey | RQCJQSMWXIRMKT-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.53 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-[5-(2-methylprop-2-enoylsulfanyl)-1,4-dithian-2-yl] 2-methylprop-2-enethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-[5-(2-methylprop-2-enoylsulfanyl)-1,4-dithian-2-yl] 2-methylprop-2-enethioate?
The IUPAC name of S-[5-(2-methylprop-2-enoylsulfanyl)-1,4-dithian-2-yl] 2-methylprop-2-enethioate (CID 14876306) is S-[5-(2-methylprop-2-enoylsulfanyl)-1,4-dithian-2-yl] 2-methylprop-2-enethioate.
What is the SMILES notation for S-[5-(2-methylprop-2-enoylsulfanyl)-1,4-dithian-2-yl] 2-methylprop-2-enethioate?
The canonical SMILES for S-[5-(2-methylprop-2-enoylsulfanyl)-1,4-dithian-2-yl] 2-methylprop-2-enethioate is C=C(C)C(=O)SC1CSC(SC(=O)C(=C)C)CS1.
What is the InChIKey of S-[5-(2-methylprop-2-enoylsulfanyl)-1,4-dithian-2-yl] 2-methylprop-2-enethioate?
The InChIKey is RQCJQSMWXIRMKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O2S4/c1-7(2)11(13)17-9-5-16-10(6-15-9)18-12(14)8(3)4/h9-10H,1,3,5-6H2,2,4H3.
What are the key properties of S-[5-(2-methylprop-2-enoylsulfanyl)-1,4-dithian-2-yl] 2-methylprop-2-enethioate?
S-[5-(2-methylprop-2-enoylsulfanyl)-1,4-dithian-2-yl] 2-methylprop-2-enethioate has a molecular weight of 320.53 g/mol, XLogP of 3.79, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for S-[5-(2-methylprop-2-enoylsulfanyl)-1,4-dithian-2-yl] 2-methylprop-2-enethioate is sourced from PubChem (CID 14876306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).