C26H25BN2O2 — CID 148766840
3-phenyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-9H-pyrrolo[3,2-b]carbazole (PubChem CID 148766840) has the molecular formula C26H25BN2O2 and a molecular weight of 408.31 g/mol. Its IUPAC name is 3-phenyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-9H-pyrrolo[3,2-b]carbazole.
| Compound Name | 3-phenyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-9H-pyrrolo[3,2-b]carbazole |
|---|---|
| PubChem CID | 148766840 |
| Molecular Formula | C26H25BN2O2 |
| Molecular Weight | 408.31 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | 3-phenyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-9H-pyrrolo[3,2-b]carbazole |
| SMILES | CC1(C)OB(c2ccc3[nH]c4cc5ccn(-c6ccccc6)c5cc4c3c2)OC1(C)C |
| InChI | InChI=1S/C26H25BN2O2/c1-25(2)26(3,4)31-27(30-25)18-10-11-22-20(15-18)21-16-24-17(14-23(21)28-22)12-13-29(24)19-8-6-5-7-9-19/h5-16,28H,1-4H3 |
| InChIKey | OHQFRVFUMKJPLX-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 39.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.31 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|