About (Z)-1-[amino(1,3-difluoropropan-2-yl)amino]-3-methylbut-1-en-2-amine
(Z)-1-[amino(1,3-difluoropropan-2-yl)amino]-3-methylbut-1-en-2-amine (PubChem CID 148769649) has the molecular formula C8H17F2N3
and a molecular weight of 193.24 g/mol. Its IUPAC name is (Z)-1-[amino(1,3-difluoropropan-2-yl)amino]-3-methylbut-1-en-2-amine.
Molecular Properties
| Compound Name | (Z)-1-[amino(1,3-difluoropropan-2-yl)amino]-3-methylbut-1-en-2-amine |
| PubChem CID | 148769649 |
| Molecular Formula | C8H17F2N3 |
| Molecular Weight | 193.24 g/mol |
| Exact Mass | 193.14 |
| IUPAC Name | (Z)-1-[amino(1,3-difluoropropan-2-yl)amino]-3-methylbut-1-en-2-amine |
| SMILES | CC(C)/C(N)=C/N(N)C(CF)CF |
| InChI | InChI=1S/C8H17F2N3/c1-6(2)8(11)5-13(12)7(3-9)4-10/h5-7H,3-4,11-12H2,1-2H3/b8-5- |
| InChIKey | OIDRDJLIBHOVIR-YVMONPNESA-N |
| XLogP | 0.93 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.24 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (Z)-1-[amino(1,3-difluoropropan-2-yl)amino]-3-methylbut-1-en-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-1-[amino(1,3-difluoropropan-2-yl)amino]-3-methylbut-1-en-2-amine?
The IUPAC name of (Z)-1-[amino(1,3-difluoropropan-2-yl)amino]-3-methylbut-1-en-2-amine (CID 148769649) is (Z)-1-[amino(1,3-difluoropropan-2-yl)amino]-3-methylbut-1-en-2-amine.
What is the SMILES notation for (Z)-1-[amino(1,3-difluoropropan-2-yl)amino]-3-methylbut-1-en-2-amine?
The canonical SMILES for (Z)-1-[amino(1,3-difluoropropan-2-yl)amino]-3-methylbut-1-en-2-amine is CC(C)/C(N)=C/N(N)C(CF)CF.
What is the InChIKey of (Z)-1-[amino(1,3-difluoropropan-2-yl)amino]-3-methylbut-1-en-2-amine?
The InChIKey is OIDRDJLIBHOVIR-YVMONPNESA-N. The full InChI is InChI=1S/C8H17F2N3/c1-6(2)8(11)5-13(12)7(3-9)4-10/h5-7H,3-4,11-12H2,1-2H3/b8-5-.
What are the key properties of (Z)-1-[amino(1,3-difluoropropan-2-yl)amino]-3-methylbut-1-en-2-amine?
(Z)-1-[amino(1,3-difluoropropan-2-yl)amino]-3-methylbut-1-en-2-amine has a molecular weight of 193.24 g/mol, XLogP of 0.93, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-1-[amino(1,3-difluoropropan-2-yl)amino]-3-methylbut-1-en-2-amine is sourced from PubChem (CID 148769649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).