About 5-chloro-3-[(6R)-3,7-dioxabicyclo[4.1.0]heptan-6-yl]pyridin-2-amine
5-chloro-3-[(6R)-3,7-dioxabicyclo[4.1.0]heptan-6-yl]pyridin-2-amine (PubChem CID 148775445) has the molecular formula C10H11ClN2O2
and a molecular weight of 226.66 g/mol. Its IUPAC name is 5-chloro-3-[(6R)-3,7-dioxabicyclo[4.1.0]heptan-6-yl]pyridin-2-amine.
Molecular Properties
| Compound Name | 5-chloro-3-[(6R)-3,7-dioxabicyclo[4.1.0]heptan-6-yl]pyridin-2-amine |
| PubChem CID | 148775445 |
| Molecular Formula | C10H11ClN2O2 |
| Molecular Weight | 226.66 g/mol |
| Exact Mass | 226.05 |
| IUPAC Name | 5-chloro-3-[(6R)-3,7-dioxabicyclo[4.1.0]heptan-6-yl]pyridin-2-amine |
| SMILES | Nc1ncc(Cl)cc1[C@]12CCOCC1O2 |
| InChI | InChI=1S/C10H11ClN2O2/c11-6-3-7(9(12)13-4-6)10-1-2-14-5-8(10)15-10/h3-4,8H,1-2,5H2,(H2,12,13)/t8?,10-/m1/s1 |
| InChIKey | OJGKKGOXEMCRMV-LHIURRSHSA-N |
| XLogP | 1.33 |
| TPSA | 60.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.66 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-3-[(6R)-3,7-dioxabicyclo[4.1.0]heptan-6-yl]pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-3-[(6R)-3,7-dioxabicyclo[4.1.0]heptan-6-yl]pyridin-2-amine?
The IUPAC name of 5-chloro-3-[(6R)-3,7-dioxabicyclo[4.1.0]heptan-6-yl]pyridin-2-amine (CID 148775445) is 5-chloro-3-[(6R)-3,7-dioxabicyclo[4.1.0]heptan-6-yl]pyridin-2-amine.
What is the SMILES notation for 5-chloro-3-[(6R)-3,7-dioxabicyclo[4.1.0]heptan-6-yl]pyridin-2-amine?
The canonical SMILES for 5-chloro-3-[(6R)-3,7-dioxabicyclo[4.1.0]heptan-6-yl]pyridin-2-amine is Nc1ncc(Cl)cc1[C@]12CCOCC1O2.
What is the InChIKey of 5-chloro-3-[(6R)-3,7-dioxabicyclo[4.1.0]heptan-6-yl]pyridin-2-amine?
The InChIKey is OJGKKGOXEMCRMV-LHIURRSHSA-N. The full InChI is InChI=1S/C10H11ClN2O2/c11-6-3-7(9(12)13-4-6)10-1-2-14-5-8(10)15-10/h3-4,8H,1-2,5H2,(H2,12,13)/t8?,10-/m1/s1.
What are the key properties of 5-chloro-3-[(6R)-3,7-dioxabicyclo[4.1.0]heptan-6-yl]pyridin-2-amine?
5-chloro-3-[(6R)-3,7-dioxabicyclo[4.1.0]heptan-6-yl]pyridin-2-amine has a molecular weight of 226.66 g/mol, XLogP of 1.33, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-3-[(6R)-3,7-dioxabicyclo[4.1.0]heptan-6-yl]pyridin-2-amine is sourced from PubChem (CID 148775445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).