C66H52F12N4 — CID 148776835
9-ethyl-3-(trifluoromethyl)-6-[1,4,4-tris[9-ethyl-6-(trifluoromethyl)carbazol-3-yl]cyclohexyl]carbazole (PubChem CID 148776835) has the molecular formula C66H52F12N4 and a molecular weight of 1129.15 g/mol. Its IUPAC name is 9-ethyl-3-(trifluoromethyl)-6-[1,4,4-tris[9-ethyl-6-(trifluoromethyl)carbazol-3-yl]cyclohexyl]carbazole.
| Compound Name | 9-ethyl-3-(trifluoromethyl)-6-[1,4,4-tris[9-ethyl-6-(trifluoromethyl)carbazol-3-yl]cyclohexyl]carbazole |
|---|---|
| PubChem CID | 148776835 |
| Molecular Formula | C66H52F12N4 |
| Molecular Weight | 1129.15 g/mol |
| Exact Mass | 1128.40 |
| IUPAC Name | 9-ethyl-3-(trifluoromethyl)-6-[1,4,4-tris[9-ethyl-6-(trifluoromethyl)carbazol-3-yl]cyclohexyl]carbazole |
| SMILES | CCn1c2ccc(C(F)(F)F)cc2c2cc(C3(c4ccc5c(c4)c4cc(C(F)(F)F)ccc4n5CC)CCC(c4ccc5c(c4)c4cc(C(F)(F)F)ccc4n5CC)(c4ccc5c(c4)c4cc(C(F)(F)F)ccc4n5CC)CC3)ccc21 |
| InChI | InChI=1S/C66H52F12N4/c1-5-79-53-17-9-37(29-45(53)49-33-41(63(67,68)69)13-21-57(49)79)61(38-10-18-54-46(30-38)50-34-42(64(70,71)72)14-22-58(50)80(54)6-2)25-27-62(28-26-61,39-11-19-55-47(31-39)51-35-43(65(73,74)75)15-23-59(51)81(55)7-3)40-12-20-56-48(32-40)52-36-44(66(76,77)78)16-24-60(52)82(56)8-4/h9-24,29-36H,5-8,25-28H2,1-4H3 |
| InChIKey | OJNMXDQNYVQVHS-UHFFFAOYSA-N |
| XLogP | 20.12 |
| TPSA | 19.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 82 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1129.15 |
| LogP ≤ 5 | 20.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |