C12H15FN5O13P3 — CID 148778253
[[(2S,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-2-fluoro-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 148778253) has the molecular formula C12H15FN5O13P3 and a molecular weight of 549.19 g/mol. Its IUPAC name is [[(2S,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-2-fluoro-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2S,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-2-fluoro-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 148778253 |
| Molecular Formula | C12H15FN5O13P3 |
| Molecular Weight | 549.19 g/mol |
| Exact Mass | 548.99 |
| IUPAC Name | [[(2S,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-2-fluoro-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | N#C[C@@]1(c2ccc3c(N)ncnn23)O[C@](F)(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C12H15FN5O13P3/c13-12(4-28-33(24,25)31-34(26,27)30-32(21,22)23)9(20)8(19)11(3-14,29-12)7-2-1-6-10(15)16-5-17-18(6)7/h1-2,5,8-9,19-20H,4H2,(H,24,25)(H,26,27)(H2,15,16,17)(H2,21,22,23)/t8-,9+,11+,12-/m1/s1 |
| InChIKey | OJUFSOYYTASFAB-LLHIFLOGSA-N |
| XLogP | -1.21 |
| TPSA | 289.51 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.19 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|