C7H14B2O4 — CID 148778827
2-[(2-methyl-1,3,2-dioxaborolan-4-yl)methyl]-1,3,2-dioxaborinane (PubChem CID 148778827) has the molecular formula C7H14B2O4 and a molecular weight of 183.81 g/mol. Its IUPAC name is 2-[(2-methyl-1,3,2-dioxaborolan-4-yl)methyl]-1,3,2-dioxaborinane.
| Compound Name | 2-[(2-methyl-1,3,2-dioxaborolan-4-yl)methyl]-1,3,2-dioxaborinane |
|---|---|
| PubChem CID | 148778827 |
| Molecular Formula | C7H14B2O4 |
| Molecular Weight | 183.81 g/mol |
| Exact Mass | 184.11 |
| IUPAC Name | 2-[(2-methyl-1,3,2-dioxaborolan-4-yl)methyl]-1,3,2-dioxaborinane |
| SMILES | CB1OCC(CB2OCCCO2)O1 |
| InChI | InChI=1S/C7H14B2O4/c1-8-12-6-7(13-8)5-9-10-3-2-4-11-9/h7H,2-6H2,1H3 |
| InChIKey | OJWYVHFEAKEXHZ-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.81 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|