About 2-hydroxypropyl octadecanoate
2-hydroxypropyl octadecanoate (PubChem CID 14878) has the molecular formula C21H42O3
and a molecular weight of 342.56 g/mol. Its IUPAC name is 2-hydroxypropyl octadecanoate.
Molecular Properties
| Compound Name | 2-hydroxypropyl octadecanoate |
| PubChem CID | 14878 |
| Molecular Formula | C21H42O3 |
| Molecular Weight | 342.56 g/mol |
| Exact Mass | 342.31 |
| IUPAC Name | 2-hydroxypropyl octadecanoate |
| SMILES | CCCCCCCCCCCCCCCCCC(=O)OCC(C)O |
| InChI | InChI=1S/C21H42O3/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-21(23)24-19-20(2)22/h20,22H,3-19H2,1-2H3 |
| InChIKey | FKOKUHFZNIUSLW-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 342.56 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxypropyl octadecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxypropyl octadecanoate?
The IUPAC name of 2-hydroxypropyl octadecanoate (CID 14878) is 2-hydroxypropyl octadecanoate.
What is the SMILES notation for 2-hydroxypropyl octadecanoate?
The canonical SMILES for 2-hydroxypropyl octadecanoate is CCCCCCCCCCCCCCCCCC(=O)OCC(C)O.
What is the InChIKey of 2-hydroxypropyl octadecanoate?
The InChIKey is FKOKUHFZNIUSLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H42O3/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-21(23)24-19-20(2)22/h20,22H,3-19H2,1-2H3.
What are the key properties of 2-hydroxypropyl octadecanoate?
2-hydroxypropyl octadecanoate has a molecular weight of 342.56 g/mol, XLogP of 6.17, 18 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxypropyl octadecanoate is sourced from PubChem (CID 14878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).