About propan-2-yl N-[2-hydroxy-5-[1-hydroxy-5-(4-methoxyphenyl)-4-methylpentyl]phenyl]methanimidate
propan-2-yl N-[2-hydroxy-5-[1-hydroxy-5-(4-methoxyphenyl)-4-methylpentyl]phenyl]methanimidate (PubChem CID 148781237) has the molecular formula C23H31NO4
and a molecular weight of 385.50 g/mol. Its IUPAC name is propan-2-yl N-[2-hydroxy-5-[1-hydroxy-5-(4-methoxyphenyl)-4-methylpentyl]phenyl]methanimidate.
Molecular Properties
| Compound Name | propan-2-yl N-[2-hydroxy-5-[1-hydroxy-5-(4-methoxyphenyl)-4-methylpentyl]phenyl]methanimidate |
| PubChem CID | 148781237 |
| Molecular Formula | C23H31NO4 |
| Molecular Weight | 385.50 g/mol |
| Exact Mass | 385.23 |
| IUPAC Name | propan-2-yl N-[2-hydroxy-5-[1-hydroxy-5-(4-methoxyphenyl)-4-methylpentyl]phenyl]methanimidate |
| SMILES | COc1ccc(CC(C)CCC(O)c2ccc(O)c(/N=C/OC(C)C)c2)cc1 |
| InChI | InChI=1S/C23H31NO4/c1-16(2)28-15-24-21-14-19(8-12-23(21)26)22(25)11-5-17(3)13-18-6-9-20(27-4)10-7-18/h6-10,12,14-17,22,25-26H,5,11,13H2,1-4H3/b24-15+ |
| InChIKey | OKILDEWQDQYVJX-BUVRLJJBSA-N |
| XLogP | 5.18 |
| TPSA | 71.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 385.50 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_phenol_A(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze propan-2-yl N-[2-hydroxy-5-[1-hydroxy-5-(4-methoxyphenyl)-4-methylpentyl]phenyl]methanimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl N-[2-hydroxy-5-[1-hydroxy-5-(4-methoxyphenyl)-4-methylpentyl]phenyl]methanimidate?
The IUPAC name of propan-2-yl N-[2-hydroxy-5-[1-hydroxy-5-(4-methoxyphenyl)-4-methylpentyl]phenyl]methanimidate (CID 148781237) is propan-2-yl N-[2-hydroxy-5-[1-hydroxy-5-(4-methoxyphenyl)-4-methylpentyl]phenyl]methanimidate.
What is the SMILES notation for propan-2-yl N-[2-hydroxy-5-[1-hydroxy-5-(4-methoxyphenyl)-4-methylpentyl]phenyl]methanimidate?
The canonical SMILES for propan-2-yl N-[2-hydroxy-5-[1-hydroxy-5-(4-methoxyphenyl)-4-methylpentyl]phenyl]methanimidate is COc1ccc(CC(C)CCC(O)c2ccc(O)c(/N=C/OC(C)C)c2)cc1.
What is the InChIKey of propan-2-yl N-[2-hydroxy-5-[1-hydroxy-5-(4-methoxyphenyl)-4-methylpentyl]phenyl]methanimidate?
The InChIKey is OKILDEWQDQYVJX-BUVRLJJBSA-N. The full InChI is InChI=1S/C23H31NO4/c1-16(2)28-15-24-21-14-19(8-12-23(21)26)22(25)11-5-17(3)13-18-6-9-20(27-4)10-7-18/h6-10,12,14-17,22,25-26H,5,11,13H2,1-4H3/b24-15+.
What are the key properties of propan-2-yl N-[2-hydroxy-5-[1-hydroxy-5-(4-methoxyphenyl)-4-methylpentyl]phenyl]methanimidate?
propan-2-yl N-[2-hydroxy-5-[1-hydroxy-5-(4-methoxyphenyl)-4-methylpentyl]phenyl]methanimidate has a molecular weight of 385.50 g/mol, XLogP of 5.18, 10 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl N-[2-hydroxy-5-[1-hydroxy-5-(4-methoxyphenyl)-4-methylpentyl]phenyl]methanimidate is sourced from PubChem (CID 148781237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).