About 2-[(3-chloro-2-methylphenyl)sulfanylmethyl]-4,5-dihydro-1H-imidazole;hydrochloride
2-[(3-chloro-2-methylphenyl)sulfanylmethyl]-4,5-dihydro-1H-imidazole;hydrochloride (PubChem CID 14878238) has the molecular formula C11H14Cl2N2S
and a molecular weight of 277.22 g/mol. Its IUPAC name is 2-[(3-chloro-2-methylphenyl)sulfanylmethyl]-4,5-dihydro-1H-imidazole;hydrochloride.
Molecular Properties
| Compound Name | 2-[(3-chloro-2-methylphenyl)sulfanylmethyl]-4,5-dihydro-1H-imidazole;hydrochloride |
| PubChem CID | 14878238 |
| Molecular Formula | C11H14Cl2N2S |
| Molecular Weight | 277.22 g/mol |
| Exact Mass | 276.03 |
| IUPAC Name | 2-[(3-chloro-2-methylphenyl)sulfanylmethyl]-4,5-dihydro-1H-imidazole;hydrochloride |
| SMILES | Cc1c(Cl)cccc1SCC1=NCCN1.Cl |
| InChI | InChI=1S/C11H13ClN2S.ClH/c1-8-9(12)3-2-4-10(8)15-7-11-13-5-6-14-11;/h2-4H,5-7H2,1H3,(H,13,14);1H |
| InChIKey | RBJFUVDSAHGPQK-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.22 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(3-chloro-2-methylphenyl)sulfanylmethyl]-4,5-dihydro-1H-imidazole;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3-chloro-2-methylphenyl)sulfanylmethyl]-4,5-dihydro-1H-imidazole;hydrochloride?
The IUPAC name of 2-[(3-chloro-2-methylphenyl)sulfanylmethyl]-4,5-dihydro-1H-imidazole;hydrochloride (CID 14878238) is 2-[(3-chloro-2-methylphenyl)sulfanylmethyl]-4,5-dihydro-1H-imidazole;hydrochloride.
What is the SMILES notation for 2-[(3-chloro-2-methylphenyl)sulfanylmethyl]-4,5-dihydro-1H-imidazole;hydrochloride?
The canonical SMILES for 2-[(3-chloro-2-methylphenyl)sulfanylmethyl]-4,5-dihydro-1H-imidazole;hydrochloride is Cc1c(Cl)cccc1SCC1=NCCN1.Cl.
What is the InChIKey of 2-[(3-chloro-2-methylphenyl)sulfanylmethyl]-4,5-dihydro-1H-imidazole;hydrochloride?
The InChIKey is RBJFUVDSAHGPQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13ClN2S.ClH/c1-8-9(12)3-2-4-10(8)15-7-11-13-5-6-14-11;/h2-4H,5-7H2,1H3,(H,13,14);1H.
What are the key properties of 2-[(3-chloro-2-methylphenyl)sulfanylmethyl]-4,5-dihydro-1H-imidazole;hydrochloride?
2-[(3-chloro-2-methylphenyl)sulfanylmethyl]-4,5-dihydro-1H-imidazole;hydrochloride has a molecular weight of 277.22 g/mol, XLogP of 3.16, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3-chloro-2-methylphenyl)sulfanylmethyl]-4,5-dihydro-1H-imidazole;hydrochloride is sourced from PubChem (CID 14878238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).