About N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-3-fluoro-2-methylaniline
N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-3-fluoro-2-methylaniline (PubChem CID 14878255) has the molecular formula C11H14FN3
and a molecular weight of 207.25 g/mol. Its IUPAC name is N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-3-fluoro-2-methylaniline.
Molecular Properties
| Compound Name | N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-3-fluoro-2-methylaniline |
| PubChem CID | 14878255 |
| Molecular Formula | C11H14FN3 |
| Molecular Weight | 207.25 g/mol |
| Exact Mass | 207.12 |
| IUPAC Name | N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-3-fluoro-2-methylaniline |
| SMILES | Cc1c(F)cccc1NCC1=NCCN1 |
| InChI | InChI=1S/C11H14FN3/c1-8-9(12)3-2-4-10(8)15-7-11-13-5-6-14-11/h2-4,15H,5-7H2,1H3,(H,13,14) |
| InChIKey | KNISGYATNJJJLL-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.25 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-3-fluoro-2-methylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-3-fluoro-2-methylaniline?
The IUPAC name of N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-3-fluoro-2-methylaniline (CID 14878255) is N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-3-fluoro-2-methylaniline.
What is the SMILES notation for N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-3-fluoro-2-methylaniline?
The canonical SMILES for N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-3-fluoro-2-methylaniline is Cc1c(F)cccc1NCC1=NCCN1.
What is the InChIKey of N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-3-fluoro-2-methylaniline?
The InChIKey is KNISGYATNJJJLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14FN3/c1-8-9(12)3-2-4-10(8)15-7-11-13-5-6-14-11/h2-4,15H,5-7H2,1H3,(H,13,14).
What are the key properties of N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-3-fluoro-2-methylaniline?
N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-3-fluoro-2-methylaniline has a molecular weight of 207.25 g/mol, XLogP of 1.55, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-3-fluoro-2-methylaniline is sourced from PubChem (CID 14878255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).