C23H34N5O11- — CID 148783026
2-[carboxymethyl-[2-[carboxymethyl-[2-[carboxymethyl-[2-[5-(2,5-dioxopyrrol-1-yl)pentylamino]-2-oxoethyl]amino]ethyl]amino]ethyl]amino]acetate (PubChem CID 148783026) has the molecular formula C23H34N5O11- and a molecular weight of 556.55 g/mol. Its IUPAC name is 2-[carboxymethyl-[2-[carboxymethyl-[2-[carboxymethyl-[2-[5-(2,5-dioxopyrrol-1-yl)pentylamino]-2-oxoethyl]amino]ethyl]amino]ethyl]amino]acetate.
| Compound Name | 2-[carboxymethyl-[2-[carboxymethyl-[2-[carboxymethyl-[2-[5-(2,5-dioxopyrrol-1-yl)pentylamino]-2-oxoethyl]amino]ethyl]amino]ethyl]amino]acetate |
|---|---|
| PubChem CID | 148783026 |
| Molecular Formula | C23H34N5O11- |
| Molecular Weight | 556.55 g/mol |
| Exact Mass | 556.23 |
| IUPAC Name | 2-[carboxymethyl-[2-[carboxymethyl-[2-[carboxymethyl-[2-[5-(2,5-dioxopyrrol-1-yl)pentylamino]-2-oxoethyl]amino]ethyl]amino]ethyl]amino]acetate |
| SMILES | O=C([O-])CN(CCN(CCN(CC(=O)O)CC(=O)NCCCCCN1C(=O)C=CC1=O)CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C23H35N5O11/c29-17(24-6-2-1-3-7-28-18(30)4-5-19(28)31)12-26(14-21(34)35)10-8-25(13-20(32)33)9-11-27(15-22(36)37)16-23(38)39/h4-5H,1-3,6-16H2,(H,24,29)(H,32,33)(H,34,35)(H,36,37)(H,38,39)/p-1 |
| InChIKey | OKRHTKRGPZDIMT-UHFFFAOYSA-M |
| XLogP | -3.89 |
| TPSA | 228.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.55 |
| LogP ≤ 5 | -3.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|